Difference between revisions of "PWY4FS-8"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=UDP-SULFOQUINOVOSE UDP-SULFOQUINOVOSE] == * smiles: ** C(OP(=O)([O-])OP(=O)(OC1(OC(CS(=O)(=O)[O...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Dodec-2-enoyl-ACPs Dodec-2-enoyl-ACPs] == * common name: ** a (2E)-dodec-2-enoyl-[acp] * Synony...")
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=UDP-SULFOQUINOVOSE UDP-SULFOQUINOVOSE] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Dodec-2-enoyl-ACPs Dodec-2-enoyl-ACPs] ==
* smiles:
+
** C(OP(=O)([O-])OP(=O)(OC1(OC(CS(=O)(=O)[O-])C(O)C(O)C(O)1))[O-])C2(C(O)C(O)C(O2)N3(C=CC(=O)NC(=O)3))
+
* inchi key:
+
** InChIKey=FQANCGQCBCUSMI-JZMIEXBBSA-K
+
 
* common name:
 
* common name:
** UDP-α-D-sulfoquinovopyranose
+
** a (2E)-dodec-2-enoyl-[acp]
* molecular weight:
+
** 627.34   
+
 
* Synonym(s):
 
* Synonym(s):
** UDP-6-sulfoquinovose
+
** a trans dodec-2-enoyl-[acyl-carrier protein]
** UDP-sulfoquinovose
+
** a trans dodec-2-enoyl-[acp]
** UDP-α-D-sulfoquinovose
+
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-1224]]
+
* [[RXN-9534]]
 +
* [[RXN-9661]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-1223]]
+
* [[RXN-9533]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: common name=a (2E)-dodec-2-enoyl-[acp]}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25200933 25200933]
+
{{#set: common name=a trans dodec-2-enoyl-[acyl-carrier protein]|a trans dodec-2-enoyl-[acp]}}
* CHEBI:
+
{{#set: consumed by=RXN-9534|RXN-9661}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=60009 60009]
+
{{#set: produced by=RXN-9533}}
* LIGAND-CPD:
+
** [http://www.genome.jp/dbget-bin/www_bget?C11521 C11521]
+
{{#set: smiles=C(OP(=O)([O-])OP(=O)(OC1(OC(CS(=O)(=O)[O-])C(O)C(O)C(O)1))[O-])C2(C(O)C(O)C(O2)N3(C=CC(=O)NC(=O)3))}}
+
{{#set: inchi key=InChIKey=FQANCGQCBCUSMI-JZMIEXBBSA-K}}
+
{{#set: common name=UDP-α-D-sulfoquinovopyranose}}
+
{{#set: molecular weight=627.34    }}
+
{{#set: common name=UDP-6-sulfoquinovose|UDP-sulfoquinovose|UDP-α-D-sulfoquinovose}}
+
{{#set: consumed by=RXN-1224}}
+
{{#set: produced by=RXN-1223}}
+

Revision as of 15:55, 10 January 2018

Metabolite Dodec-2-enoyl-ACPs

  • common name:
    • a (2E)-dodec-2-enoyl-[acp]
  • Synonym(s):
    • a trans dodec-2-enoyl-[acyl-carrier protein]
    • a trans dodec-2-enoyl-[acp]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"a (2E)-dodec-2-enoyl-[acp" cannot be used as a page name in this wiki.
  • "a trans dodec-2-enoyl-[acyl-carrier protein" cannot be used as a page name in this wiki.
  • "a trans dodec-2-enoyl-[acp" cannot be used as a page name in this wiki.