Difference between revisions of "SUCHMSSELCYSL"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_4461 == * Synonym(s): == Reactions associated == * RXN-15556 ** in-silico_annotation ***ec-number * UBIQUITIN--PROTEIN-LIGASE-RXN...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8646 CPD-8646] == * smiles: ** CC(C)=CCCC(C)[CH]1(CC[CH]3(C(C)1CC[CH]2(C4(C)(C(=CC=C23)CC(O...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8646 CPD-8646] == |
| + | * smiles: | ||
| + | ** CC(C)=CCCC(C)[CH]1(CC[CH]3(C(C)1CC[CH]2(C4(C)(C(=CC=C23)CC(O)CC4)))) | ||
| + | * inchi key: | ||
| + | ** InChIKey=RUSSPKPUXDSHNC-DDPQNLDTSA-N | ||
| + | * common name: | ||
| + | ** 7-dehydrodesmosterol | ||
| + | * molecular weight: | ||
| + | ** 382.628 | ||
* Synonym(s): | * Synonym(s): | ||
| + | ** 5α-cholesta-5,7,24-trien-3β-ol | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | * [[RXN66-27]] |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | * [[RXN66-26]] | |
| − | * [[ | + | == Reaction(s) of unknown directionality == |
| − | + | ||
| − | + | ||
| − | == | + | |
| − | + | ||
== External links == | == External links == | ||
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=440558 440558] |
| + | * CHEBI: | ||
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=27910 27910] | ||
| + | * LIGAND-CPD: | ||
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C05107 C05107] | ||
| + | * HMDB : HMDB03896 | ||
| + | {{#set: smiles=CC(C)=CCCC(C)[CH]1(CC[CH]3(C(C)1CC[CH]2(C4(C)(C(=CC=C23)CC(O)CC4))))}} | ||
| + | {{#set: inchi key=InChIKey=RUSSPKPUXDSHNC-DDPQNLDTSA-N}} | ||
| + | {{#set: common name=7-dehydrodesmosterol}} | ||
| + | {{#set: molecular weight=382.628 }} | ||
| + | {{#set: common name=5α-cholesta-5,7,24-trien-3β-ol}} | ||
| + | {{#set: consumed by=RXN66-27}} | ||
| + | {{#set: produced by=RXN66-26}} | ||
Revision as of 15:56, 10 January 2018
Contents
Metabolite CPD-8646
- smiles:
- CC(C)=CCCC(C)[CH]1(CC[CH]3(C(C)1CC[CH]2(C4(C)(C(=CC=C23)CC(O)CC4))))
- inchi key:
- InChIKey=RUSSPKPUXDSHNC-DDPQNLDTSA-N
- common name:
- 7-dehydrodesmosterol
- molecular weight:
- 382.628
- Synonym(s):
- 5α-cholesta-5,7,24-trien-3β-ol
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(C)=CCCC(C)[CH]1(CC[CH]3(C(C)1CC[CH]2(C4(C)(C(=CC=C23)CC(O)CC4))))" cannot be used as a page name in this wiki.
