Difference between revisions of "Tiso gene 15880"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19489 CPD-19489] == * smiles: ** CSCCCCCC(C(=O)C(=O)[O-])C(=O)[O-] * inchi key: ** InChIKey...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-10721 RXN-10721] == * direction: ** REVERSIBLE * common name: ** 3-hydroxy-L-kynurenine-oxoglut...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Reaction]] |
| − | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-10721 RXN-10721] == |
| − | * | + | * direction: |
| − | ** | + | ** REVERSIBLE |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** 3- | + | ** 3-hydroxy-L-kynurenine-oxoglutarate transaminase |
| − | * | + | * ec number: |
| − | ** | + | ** [http://enzyme.expasy.org/EC/2.6.1.7 EC-2.6.1.7] |
* Synonym(s): | * Synonym(s): | ||
| − | == Reaction(s) | + | == Reaction Formula == |
| − | * [[ | + | * With identifiers: |
| − | == | + | ** 1 [[2-KETOGLUTARATE]][c] '''+''' 1 [[3-HYDROXY-L-KYNURENINE]][c] '''<=>''' 1 [[CPD-11552]][c] '''+''' 1 [[GLT]][c] |
| − | == | + | * With common name(s): |
| − | * [[ | + | ** 1 2-oxoglutarate[c] '''+''' 1 3-hydroxy-L-kynurenine[c] '''<=>''' 1 4-(2-amino-3-hydroxyphenyl)-2,4-dioxobutanoate[c] '''+''' 1 L-glutamate[c] |
| + | |||
| + | == Genes associated with this reaction == | ||
| + | Genes have been associated with this reaction based on different elements listed below. | ||
| + | * [[Tiso_gene_15680]] | ||
| + | ** [[pantograph]]-[[esiliculosus]] | ||
| + | == Pathways == | ||
| + | * [[PWY-6309]], L-tryptophan degradation XI (mammalian, via kynurenine): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6309 PWY-6309] | ||
| + | ** '''9''' reactions found over '''17''' reactions in the full pathway | ||
| + | == Reconstruction information == | ||
| + | * [[orthology]]: | ||
| + | ** [[pantograph]]: | ||
| + | *** [[esiliculosus]] | ||
== External links == | == External links == | ||
| − | {{#set: | + | * LIGAND-RXN: |
| − | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?R04171 R04171] |
| − | {{#set: | + | {{#set: direction=REVERSIBLE}} |
| − | {{#set: | + | {{#set: common name=3-hydroxy-L-kynurenine-oxoglutarate transaminase}} |
| − | {{#set: | + | {{#set: ec number=EC-2.6.1.7}} |
| − | {{#set: | + | {{#set: gene associated=Tiso_gene_15680}} |
| + | {{#set: in pathway=PWY-6309}} | ||
| + | {{#set: reconstruction category=orthology}} | ||
| + | {{#set: reconstruction tool=pantograph}} | ||
| + | {{#set: reconstruction source=esiliculosus}} | ||
Revision as of 15:57, 10 January 2018
Contents
Reaction RXN-10721
- direction:
- REVERSIBLE
- common name:
- 3-hydroxy-L-kynurenine-oxoglutarate transaminase
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 2-KETOGLUTARATE[c] + 1 3-HYDROXY-L-KYNURENINE[c] <=> 1 CPD-11552[c] + 1 GLT[c]
- With common name(s):
- 1 2-oxoglutarate[c] + 1 3-hydroxy-L-kynurenine[c] <=> 1 4-(2-amino-3-hydroxyphenyl)-2,4-dioxobutanoate[c] + 1 L-glutamate[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
Pathways
- PWY-6309, L-tryptophan degradation XI (mammalian, via kynurenine): PWY-6309
- 9 reactions found over 17 reactions in the full pathway
Reconstruction information
External links
- LIGAND-RXN:
