Difference between revisions of "Tiso gene 11362"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15977 CPD-15977] == * smiles: ** CCCCCCCCC=CCCCCCCCC(=O)OCC(CO)OC(CCCCCCCC=CCCCCCCCC)=O * i...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-16025 RXN-16025] == * direction: ** LEFT-TO-RIGHT * common name: ** 1-acylglycerol-3-phosphate_...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-16025 RXN-16025] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** 1 | + | ** 1-acylglycerol-3-phosphate_o-acyltransferase |
− | * | + | * ec number: |
− | ** | + | ** [http://enzyme.expasy.org/EC/2.3.1.51 EC-2.3.1.51] |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == Reaction | + | == Reaction Formula == |
− | = | + | * With identifiers: |
− | * [[ | + | ** 1 [[CPD0-2113]][c] '''+''' 1 [[Palmitoyl-ACPs]][c] '''=>''' 1 [[ACP]][c] '''+''' 1 [[CPD-17273]][c] |
− | == | + | * With common name(s): |
+ | ** 1 1-stearoyl-sn-glycerol 3-phosphate[c] '''+''' 1 a palmitoyl-[acp][c] '''=>''' 1 a holo-[acyl-carrier protein][c] '''+''' 1 1-stearoyl-2-palmitoyl-sn-glycerol 3-phosphate[c] | ||
+ | |||
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * [[Tiso_gene_13959]] | ||
+ | ** IN-SILICO_ANNOTATION | ||
+ | ***EC-NUMBER | ||
+ | ** EXPERIMENTAL_ANNOTATION | ||
+ | ***EC-NUMBER | ||
+ | == Pathways == | ||
+ | == Reconstruction information == | ||
+ | * [[annotation]]: | ||
+ | ** [[pathwaytools]]: | ||
+ | *** [[experimental_annotation]] | ||
+ | *** [[in-silico_annotation]] | ||
== External links == | == External links == | ||
− | + | {{#set: direction=LEFT-TO-RIGHT}} | |
− | + | {{#set: common name=1-acylglycerol-3-phosphate_o-acyltransferase}} | |
− | + | {{#set: ec number=EC-2.3.1.51}} | |
− | + | {{#set: gene associated=Tiso_gene_13959}} | |
− | + | {{#set: in pathway=}} | |
− | + | {{#set: reconstruction category=annotation}} | |
− | + | {{#set: reconstruction tool=pathwaytools}} | |
− | {{#set: | + | {{#set: reconstruction source=experimental_annotation|in-silico_annotation}} |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 15:57, 10 January 2018
Contents
Reaction RXN-16025
- direction:
- LEFT-TO-RIGHT
- common name:
- 1-acylglycerol-3-phosphate_o-acyltransferase
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 CPD0-2113[c] + 1 Palmitoyl-ACPs[c] => 1 ACP[c] + 1 CPD-17273[c]
- With common name(s):
- 1 1-stearoyl-sn-glycerol 3-phosphate[c] + 1 a palmitoyl-[acp][c] => 1 a holo-[acyl-carrier protein][c] + 1 1-stearoyl-2-palmitoyl-sn-glycerol 3-phosphate[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Tiso_gene_13959
- IN-SILICO_ANNOTATION
- EC-NUMBER
- EXPERIMENTAL_ANNOTATION
- EC-NUMBER
- IN-SILICO_ANNOTATION