Difference between revisions of "PWY-7295"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8625 CPD-8625] == * common name: ** a [protein]-L-proline (ω = 0) * Synonym(s): ** a...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14115 CPD-14115] == * smiles: ** C3(C(C1(CC2(=CC=C(C=C(OC1)2)O)))=CC=C(C=3)O) * inchi key:...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD- | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14115 CPD-14115] == |
+ | * smiles: | ||
+ | ** C3(C(C1(CC2(=CC=C(C=C(OC1)2)O)))=CC=C(C=3)O) | ||
+ | * inchi key: | ||
+ | ** InChIKey=ADFCQWZHKCXPAJ-GFCCVEGCSA-N | ||
* common name: | * common name: | ||
− | ** | + | ** (S)-equol |
+ | * molecular weight: | ||
+ | ** 242.274 | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** 4',7-isoflavandiol |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | * [[ | + | * [[RXN-15589]] |
== External links == | == External links == | ||
− | {{#set: | + | * LIGAND-CPD: |
− | {{#set: common name= | + | ** [http://www.genome.jp/dbget-bin/www_bget?C14131 C14131] |
− | {{#set: consumed or produced by= | + | * Wikipedia : Equol |
+ | * HMDB : HMDB02209 | ||
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=34741 34741] | ||
+ | * PUBCHEM: | ||
+ | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=91469 91469] | ||
+ | {{#set: smiles=C3(C(C1(CC2(=CC=C(C=C(OC1)2)O)))=CC=C(C=3)O)}} | ||
+ | {{#set: inchi key=InChIKey=ADFCQWZHKCXPAJ-GFCCVEGCSA-N}} | ||
+ | {{#set: common name=(S)-equol}} | ||
+ | {{#set: molecular weight=242.274 }} | ||
+ | {{#set: common name=4',7-isoflavandiol}} | ||
+ | {{#set: consumed or produced by=RXN-15589}} |
Revision as of 15:57, 10 January 2018
Contents
Metabolite CPD-14115
- smiles:
- C3(C(C1(CC2(=CC=C(C=C(OC1)2)O)))=CC=C(C=3)O)
- inchi key:
- InChIKey=ADFCQWZHKCXPAJ-GFCCVEGCSA-N
- common name:
- (S)-equol
- molecular weight:
- 242.274
- Synonym(s):
- 4',7-isoflavandiol
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links