Difference between revisions of "PWY-881"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RME144 RME144] == * direction: ** LEFT-TO-RIGHT * common name: ** RME144 * Synonym(s): == Reaction...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-5721 CPD-5721] == * smiles: ** C1(N=C2(N=C(N)N=C([S-])C(N=1)2)) * inchi key: ** InChIKey=UH...")
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RME144 RME144] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-5721 CPD-5721] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** C1(N=C2(N=C(N)N=C([S-])C(N=1)2))
 +
* inchi key:
 +
** InChIKey=UHLHHUAQNRJGFS-UHFFFAOYSA-M
 
* common name:
 
* common name:
−
** RME144
+
** thioguanine
 +
* molecular weight:
 +
** 166.18   
 
* Synonym(s):
 
* Synonym(s):
 +
** 6-thioguanine
 +
** 6-mercaptoguanine
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
== Reaction(s) known to produce the compound ==
−
** 0.047 [[ASN]][c] '''+''' 0.037 [[ILE]][c] '''+''' 0.001 [[TRP]][c] '''+''' 4.306 [[ATP]][c] '''+''' 0.009 [[4-HYDROXY-L-PROLINE]][c] '''+''' 0.047 [[L-ASPARTATE]][c] '''+''' 0.111 [[L-ALPHA-ALANINE]][c] '''+''' 0.041 [[PHE]][c] '''+''' 0.056 [[THR]][c] '''+''' 3.306 [[WATER]][c] '''+''' 0.054 [[SER]][c] '''+''' 0.052 [[GLT]][c] '''+''' 0.024 [[MET]][c] '''+''' 0.03 [[TYR]][c] '''+''' 0.012 [[CYS]][c] '''+''' 0.056 [[PRO]][c] '''+''' 0.092 [[GLY]][c] '''+''' 0.017 [[HIS]][c] '''+''' 0.052 [[ARG]][c] '''+''' 0.09 [[LEU]][c] '''+''' 0.061 [[VAL]][c] '''+''' 0.06 [[LYS]][c] '''+''' 0.052 [[GLN]][c] '''=>''' 1.0 [[General-Protein-Substrates]][c] '''+''' 4.306 [[Pi]][c] '''+''' 4.319 [[PROTON]][c] '''+''' 4.306 [[ADP]][c]
+
== Reaction(s) of unknown directionality ==
−
* With common name(s):
+
* [[TGUAt]]
−
** 0.047 L-asparagine[c] '''+''' 0.037 L-isoleucine[c] '''+''' 0.001 L-tryptophan[c] '''+''' 4.306 ATP[c] '''+''' 0.009 trans-4-hydroxy-L-proline[c] '''+''' 0.047 L-aspartate[c] '''+''' 0.111 L-alanine[c] '''+''' 0.041 L-phenylalanine[c] '''+''' 0.056 L-threonine[c] '''+''' 3.306 H2O[c] '''+''' 0.054 L-serine[c] '''+''' 0.052 L-glutamate[c] '''+''' 0.024 L-methionine[c] '''+''' 0.03 L-tyrosine[c] '''+''' 0.012 L-cysteine[c] '''+''' 0.056 L-proline[c] '''+''' 0.092 glycine[c] '''+''' 0.017 L-histidine[c] '''+''' 0.052 L-arginine[c] '''+''' 0.09 L-leucine[c] '''+''' 0.061 L-valine[c] '''+''' 0.06 L-lysine[c] '''+''' 0.052 L-glutamine[c] '''=>''' 1.0 a protein[c] '''+''' 4.306 phosphate[c] '''+''' 4.319 H+[c] '''+''' 4.306 ADP[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
== Pathways  ==
+
−
== Reconstruction information  ==
+
−
* [[manual]]:
+
−
** [[primary_network]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* DRUGBANK : DB00352
−
{{#set: common name=RME144}}
+
* LIGAND-CPD:
−
{{#set: in pathway=}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C07648 C07648]
−
{{#set: reconstruction category=manual}}
+
* CHEBI:
−
{{#set: reconstruction source=primary_network}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=9555 9555]
 +
* PUBCHEM:
 +
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25203152 25203152]
 +
* HMDB : HMDB14496
 +
{{#set: smiles=C1(N=C2(N=C(N)N=C([S-])C(N=1)2))}}
 +
{{#set: inchi key=InChIKey=UHLHHUAQNRJGFS-UHFFFAOYSA-M}}
 +
{{#set: common name=thioguanine}}
 +
{{#set: molecular weight=166.18    }}
 +
{{#set: common name=6-thioguanine|6-mercaptoguanine}}
 +
{{#set: consumed or produced by=TGUAt}}

Revision as of 15:58, 10 January 2018

Metabolite CPD-5721

  • smiles:
    • C1(N=C2(N=C(N)N=C([S-])C(N=1)2))
  • inchi key:
    • InChIKey=UHLHHUAQNRJGFS-UHFFFAOYSA-M
  • common name:
    • thioguanine
  • molecular weight:
    • 166.18
  • Synonym(s):
    • 6-thioguanine
    • 6-mercaptoguanine

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C1(N=C2(N=C(N)N=C([S-])C(N=1)2))" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=PWY-881&oldid=11053"