Difference between revisions of "PWY-6535"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14876 CPD-14876] == * smiles: ** CC(=O)NC1(=CC([CH]=O)=CC=C([O-])1) * inchi key: ** InChIKe...") |
(Created page with "Category:Gene == Gene Tiso_gene_3274 == * Synonym(s): == Reactions associated == * RXN-4303 ** pantograph-athaliana ** pantograph-esiliculosus * RXN...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Gene]] |
| − | == | + | == Gene Tiso_gene_3274 == |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | == | + | == Reactions associated == |
| − | + | * [[RXN-4303]] | |
| − | == | + | ** [[pantograph]]-[[athaliana]] |
| − | * [[ | + | ** [[pantograph]]-[[esiliculosus]] |
| + | * [[RXN-4305]] | ||
| + | ** [[pantograph]]-[[athaliana]] | ||
| + | ** [[pantograph]]-[[esiliculosus]] | ||
| + | * [[RXN0-6274]] | ||
| + | ** [[pantograph]]-[[esiliculosus]] | ||
| + | == Pathways associated == | ||
| + | * [[PWY-2681]] | ||
| + | * [[PWY-2781]] | ||
== External links == | == External links == | ||
| − | + | {{#set: reaction associated=RXN-4303|RXN-4305|RXN0-6274}} | |
| − | + | {{#set: pathway associated=PWY-2681|PWY-2781}} | |
| − | {{#set: | + | |
| − | + | ||
| − | {{#set: | + | |
| − | + | ||
| − | + | ||
Revision as of 16:58, 10 January 2018
Gene Tiso_gene_3274
- Synonym(s):
