Difference between revisions of "PWY-6525"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-Palmitoyl-L-Phosphatidate 2-Palmitoyl-L-Phosphatidate] == * common name: ** a 1-acyl-2-palmit...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN1G-686 RXN1G-686] == * direction: ** LEFT-TO-RIGHT * common name: ** trans-delta2-cis,cis-delta9...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN1G-686 RXN1G-686] == |
+ | * direction: | ||
+ | ** LEFT-TO-RIGHT | ||
* common name: | * common name: | ||
− | ** | + | ** trans-delta2-cis,cis-delta9,27-C46:3-[acyl-carrier protein] reductase |
+ | * ec number: | ||
+ | ** [http://enzyme.expasy.org/EC/1.3.1.M4 EC-1.3.1.M4] | ||
* Synonym(s): | * Synonym(s): | ||
− | == Reaction(s) | + | == Reaction Formula == |
− | == | + | * With identifiers: |
− | * [[ | + | ** 1 [[trans-D2-cis-cis-D9-27-C46-3-ACPs]][c] '''+''' 1 [[NADH]][c] '''+''' 1 [[PROTON]][c] '''=>''' 1 [[NAD]][c] '''+''' 1 [[cis-cis-D9-27-C46-2-ACPs]][c] |
− | == | + | * With common name(s): |
+ | ** 1 a trans-delta2-cis,cis-delta9,27-C46:3-[acp][c] '''+''' 1 NADH[c] '''+''' 1 H+[c] '''=>''' 1 NAD+[c] '''+''' 1 a cis,cis-delta9,27-C46:2-[acp][c] | ||
+ | |||
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * [[Tiso_gene_10778]] | ||
+ | ** [[pantograph]]-[[esiliculosus]] | ||
+ | == Pathways == | ||
+ | * [[PWYG-321]], mycolate biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWYG-321 PWYG-321] | ||
+ | ** '''86''' reactions found over '''182''' reactions in the full pathway | ||
+ | == Reconstruction information == | ||
+ | * [[orthology]]: | ||
+ | ** [[pantograph]]: | ||
+ | *** [[esiliculosus]] | ||
== External links == | == External links == | ||
− | {{#set: common name= | + | {{#set: direction=LEFT-TO-RIGHT}} |
− | {{#set: | + | {{#set: common name=trans-delta2-cis,cis-delta9,27-C46:3-[acyl-carrier protein] reductase}} |
+ | {{#set: ec number=EC-1.3.1.M4}} | ||
+ | {{#set: gene associated=Tiso_gene_10778}} | ||
+ | {{#set: in pathway=PWYG-321}} | ||
+ | {{#set: reconstruction category=orthology}} | ||
+ | {{#set: reconstruction tool=pantograph}} | ||
+ | {{#set: reconstruction source=esiliculosus}} |
Revision as of 16:58, 10 January 2018
Contents
Reaction RXN1G-686
- direction:
- LEFT-TO-RIGHT
- common name:
- trans-delta2-cis,cis-delta9,27-C46:3-[acyl-carrier protein] reductase
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 trans-D2-cis-cis-D9-27-C46-3-ACPs[c] + 1 NADH[c] + 1 PROTON[c] => 1 NAD[c] + 1 cis-cis-D9-27-C46-2-ACPs[c]
- With common name(s):
- 1 a trans-delta2-cis,cis-delta9,27-C46:3-[acp][c] + 1 NADH[c] + 1 H+[c] => 1 NAD+[c] + 1 a cis,cis-delta9,27-C46:2-[acp][c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
Pathways
Reconstruction information
External links
"trans-delta2-cis,cis-delta9,27-C46:3-[acyl-carrier protein] reductase" cannot be used as a page name in this wiki.