Difference between revisions of "Tiso gene 15329"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13913 CPD-13913] == * smiles: ** C(O)C1(OC(=O)C(O)(C(=O)[O-])C(O)1) * inchi key: ** InChIKe...")
 
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7159 PWY-7159] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-241806 TAX-...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Pathway]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13913 CPD-13913] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7159 PWY-7159] ==
−
* smiles:
+
* taxonomic range:
−
** C(O)C1(OC(=O)C(O)(C(=O)[O-])C(O)1)
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-241806 TAX-241806]
−
* inchi key:
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
−
** InChIKey=ZNJUNWARRIXWAA-UHFFFAOYSA-M
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-1117 TAX-1117]
 +
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-3041 TAX-3041]
 +
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-3312 TAX-3312]
 +
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-3208 TAX-3208]
 
* common name:
 
* common name:
−
** 2-carboxy-L-xylonolactone
+
** 3,8-divinyl-chlorophyllide a biosynthesis III (aerobic, light independent)
−
* molecular weight:
+
−
** 191.117   
+
 
* Synonym(s):
 
* Synonym(s):
 +
** light-independent aerobic 3,8-divinyl-chlorophyllide a biosynthesis
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
−
* [[RXN-12871]]
+
* '''8''' reaction(s) found
−
== Reaction(s) known to produce the compound ==
+
** [[RXN1F-20]]
−
* [[RXN-12870]]
+
** [[RXN0-1461]]
−
== Reaction(s) of unknown directionality ==
+
** [[RXN-5282]]
 +
** [[RXN-5283]]
 +
** [[RXN-5284]]
 +
** [[RXN-MG-PROTOPORPHYRIN-METHYLESTER-SYN]]
 +
** [[UROGENDECARBOX-RXN]]
 +
** [[PROTOPORGENOXI-RXN]]
 +
== Reaction(s) not found ==
 +
* '''1''' reaction(s) not found
 +
** [http://metacyc.org/META/NEW-IMAGE?object=RXN-17485 RXN-17485]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
* PLANTCYC : PWY-7159
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90658445 90658445]
+
{{#set: taxonomic range=TAX-241806}}
−
{{#set: smiles=C(O)C1(OC(=O)C(O)(C(=O)[O-])C(O)1)}}
+
{{#set: taxonomic range=TAX-2}}
−
{{#set: inchi key=InChIKey=ZNJUNWARRIXWAA-UHFFFAOYSA-M}}
+
{{#set: taxonomic range=TAX-1117}}
−
{{#set: common name=2-carboxy-L-xylonolactone}}
+
{{#set: taxonomic range=TAX-3041}}
−
{{#set: molecular weight=191.117    }}
+
{{#set: taxonomic range=TAX-3312}}
−
{{#set: consumed by=RXN-12871}}
+
{{#set: taxonomic range=TAX-3208}}
−
{{#set: produced by=RXN-12870}}
+
{{#set: common name=3,8-divinyl-chlorophyllide a biosynthesis III (aerobic, light independent)}}
 +
{{#set: common name=light-independent aerobic 3,8-divinyl-chlorophyllide a biosynthesis}}
 +
{{#set: reaction found=8}}
 +
{{#set: reaction not found=1}}

Revision as of 15:59, 10 January 2018

Pathway PWY-7159

  • taxonomic range:
  • common name:
    • 3,8-divinyl-chlorophyllide a biosynthesis III (aerobic, light independent)
  • Synonym(s):
    • light-independent aerobic 3,8-divinyl-chlorophyllide a biosynthesis

Reaction(s) found

Reaction(s) not found

External links

  • PLANTCYC : PWY-7159






Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_15329&oldid=11119"