Difference between revisions of "RXN-17010"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12935 CPD-12935] == * smiles: ** CC(C=CC=C(C)C=CC=C(C)C=O)=CC=CC=C(C)C=CC=C(C)C=CC1(C(C)(C)...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-10660 RXN-10660] == * direction: ** LEFT-TO-RIGHT * common name: ** 3-hydroxyacyl-[acyl-carrier...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12935 CPD-12935] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-10660 RXN-10660] ==
−
* smiles:
+
* direction:
−
** CC(C=CC=C(C)C=CC=C(C)C=O)=CC=CC=C(C)C=CC=C(C)C=CC1(C(C)(C)CCCC(C)=1)
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=FTQSFEZUHZHOAT-BRZOAGJPSA-N
+
 
* common name:
 
* common name:
−
** 4'-apo-β-carotenal
+
** 3-hydroxyacyl-[acyl-carrier-protein] dehydratase
−
* molecular weight:
+
* ec number:
−
** 482.748   
+
** [http://enzyme.expasy.org/EC/4.2.1.59 EC-4.2.1.59]
 
* Synonym(s):
 
* Synonym(s):
−
** β-apo-4'-carotenal
 
−
** 4'-apo-β,ψ-caroten-4'-al
 
−
** 4'-apo-β,ψ-carotenal
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
== Reaction(s) known to produce the compound ==
+
* With identifiers:
−
* [[RXN-11989]]
+
** 1 [[3-hydroxy-cis-D9-hexaecenoyl-ACPs]][c] '''=>''' 1 [[WATER]][c] '''+''' 1 [[Trans-D3-cis-D9-hexadecenoyl-ACPs]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 a (3R)-3-hydroxy cis Δ9-hexadecenoyl-[acp][c] '''=>''' 1 H2O[c] '''+''' 1 a trans-Δ3-cis-Δ9-hexadecenoyl-[acp][c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* [[Tiso_gene_6884]]
 +
** EXPERIMENTAL_ANNOTATION
 +
***AUTOMATED-NAME-MATCH
 +
== Pathways  ==
 +
* [[PWY-6282]], palmitoleate biosynthesis I (from (5Z)-dodec-5-enoate): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6282 PWY-6282]
 +
** '''9''' reactions found over '''9''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* [[annotation]]:
 +
** [[pathwaytools]]:
 +
*** [[experimental_annotation]]
 
== External links  ==
 
== External links  ==
−
* LIGAND-CPD:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C19892 C19892]
+
{{#set: common name=3-hydroxyacyl-[acyl-carrier-protein] dehydratase}}
−
* CHEBI:
+
{{#set: ec number=EC-4.2.1.59}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=53157 53157]
+
{{#set: gene associated=Tiso_gene_6884}}
−
* PUBCHEM:
+
{{#set: in pathway=PWY-6282}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44224033 44224033]
+
{{#set: reconstruction category=annotation}}
−
{{#set: smiles=CC(C=CC=C(C)C=CC=C(C)C=O)=CC=CC=C(C)C=CC=C(C)C=CC1(C(C)(C)CCCC(C)=1)}}
+
{{#set: reconstruction tool=pathwaytools}}
−
{{#set: inchi key=InChIKey=FTQSFEZUHZHOAT-BRZOAGJPSA-N}}
+
{{#set: reconstruction source=experimental_annotation}}
−
{{#set: common name=4'-apo-β-carotenal}}
+
−
{{#set: molecular weight=482.748    }}
+
−
{{#set: common name=β-apo-4'-carotenal|4'-apo-β,ψ-caroten-4'-al|4'-apo-β,ψ-carotenal}}
+
−
{{#set: produced by=RXN-11989}}
+

Revision as of 15:59, 10 January 2018

Reaction RXN-10660

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • 3-hydroxyacyl-[acyl-carrier-protein] dehydratase
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-6282, palmitoleate biosynthesis I (from (5Z)-dodec-5-enoate): PWY-6282
    • 9 reactions found over 9 reactions in the full pathway

Reconstruction information

External links

"3-hydroxyacyl-[acyl-carrier-protein] dehydratase" cannot be used as a page name in this wiki.




Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=RXN-17010&oldid=11142"