Difference between revisions of "PWY-5047"
From metabolic_network
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7274 PWY-7274] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2062 TAX-20...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GUANOSINE-5DP-3DP GUANOSINE-5DP-3DP] == * smiles: ** C(OP(=O)([O-])OP(=O)(O)[O-])C1(OC(C(O)C(OP...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GUANOSINE-5DP-3DP GUANOSINE-5DP-3DP] == |
− | * | + | * smiles: |
− | ** [ | + | ** C(OP(=O)([O-])OP(=O)(O)[O-])C1(OC(C(O)C(OP([O-])(=O)OP([O-])([O-])=O)1)N3(C=NC2(C(=O)NC(N)=NC=23))) |
+ | * inchi key: | ||
+ | ** InChIKey=BUFLLCUFNHESEH-UUOKFMHZSA-I | ||
* common name: | * common name: | ||
− | ** | + | ** ppGpp |
+ | * molecular weight: | ||
+ | ** 598.123 | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** guanosine tetraphosphate | ||
+ | ** guanosine 5'-diphosphate,3'-diphosphate | ||
+ | ** guanosine 3',5'-bispyrophosphate | ||
+ | ** guanosine 3',5'-bis(diphosphate) | ||
+ | ** guanosine 3'-diphosphate 5'-diphosphate | ||
+ | ** magic spot | ||
+ | ** guanosine-5',3'-tetraphosphate | ||
− | == Reaction(s) | + | == Reaction(s) known to consume the compound == |
− | + | * [[PPGPPSYN-RXN]] | |
− | + | == Reaction(s) known to produce the compound == | |
− | == Reaction(s) | + | * [[GDPPYPHOSKIN-RXN]] |
− | + | == Reaction(s) of unknown directionality == | |
− | + | * [[GBDP]] | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | {{#set: | + | * DRUGBANK : DB04022 |
− | {{#set: common name= | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=15938967 15938967] |
− | {{#set: | + | * HMDB : HMDB59638 |
+ | * LIGAND-CPD: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C01228 C01228] | ||
+ | * CHEMSPIDER: | ||
+ | ** [http://www.chemspider.com/Chemical-Structure.13082026.html 13082026] | ||
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=77828 77828] | ||
+ | * BIGG : ppgpp | ||
+ | {{#set: smiles=C(OP(=O)([O-])OP(=O)(O)[O-])C1(OC(C(O)C(OP([O-])(=O)OP([O-])([O-])=O)1)N3(C=NC2(C(=O)NC(N)=NC=23)))}} | ||
+ | {{#set: inchi key=InChIKey=BUFLLCUFNHESEH-UUOKFMHZSA-I}} | ||
+ | {{#set: common name=ppGpp}} | ||
+ | {{#set: molecular weight=598.123 }} | ||
+ | {{#set: common name=guanosine tetraphosphate|guanosine 5'-diphosphate,3'-diphosphate|guanosine 3',5'-bispyrophosphate|guanosine 3',5'-bis(diphosphate)|guanosine 3'-diphosphate 5'-diphosphate|magic spot|guanosine-5',3'-tetraphosphate}} | ||
+ | {{#set: consumed by=PPGPPSYN-RXN}} | ||
+ | {{#set: produced by=GDPPYPHOSKIN-RXN}} | ||
+ | {{#set: consumed or produced by=GBDP}} |
Revision as of 16:00, 10 January 2018
Contents
Metabolite GUANOSINE-5DP-3DP
- smiles:
- C(OP(=O)([O-])OP(=O)(O)[O-])C1(OC(C(O)C(OP([O-])(=O)OP([O-])([O-])=O)1)N3(C=NC2(C(=O)NC(N)=NC=23)))
- inchi key:
- InChIKey=BUFLLCUFNHESEH-UUOKFMHZSA-I
- common name:
- ppGpp
- molecular weight:
- 598.123
- Synonym(s):
- guanosine tetraphosphate
- guanosine 5'-diphosphate,3'-diphosphate
- guanosine 3',5'-bispyrophosphate
- guanosine 3',5'-bis(diphosphate)
- guanosine 3'-diphosphate 5'-diphosphate
- magic spot
- guanosine-5',3'-tetraphosphate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- DRUGBANK : DB04022
- PUBCHEM:
- HMDB : HMDB59638
- LIGAND-CPD:
- CHEMSPIDER:
- CHEBI:
- BIGG : ppgpp
"C(OP(=O)([O-])OP(=O)(O)[O-])C1(OC(C(O)C(OP([O-])(=O)OP([O-])([O-])=O)1)N3(C=NC2(C(=O)NC(N)=NC=23)))" cannot be used as a page name in this wiki.