Difference between revisions of "PWY-5951"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-140 CPD1F-140] == * smiles: ** C=C1(C3(O)(CC4(C1)(C([CH]5(C2(C(=O)OC(CCC2)([CH](CC3)4)5)(...")
 
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5392 PWY-5392] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-200783 TAX-...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Pathway]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-140 CPD1F-140] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5392 PWY-5392] ==
−
* smiles:
+
* taxonomic range:
−
** C=C1(C3(O)(CC4(C1)(C([CH]5(C2(C(=O)OC(CCC2)([CH](CC3)4)5)(C)))C([O-])=O)))
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-200783 TAX-200783]
−
* inchi key:
+
−
** InChIKey=OXFPYCSNYOFUCH-AODVQFRNSA-M
+
 
* common name:
 
* common name:
−
** gibberellin A20
+
** reductive TCA cycle II
−
* molecular weight:
+
−
** 331.388   
+
 
* Synonym(s):
 
* Synonym(s):
−
** GA20
+
** reductive tricarboxylic acid cycle
 +
** reductive tricarboxylic acid pathway
 +
** reductive citric acid cycle
 +
** reverse citric acid cycle
 +
** carbon fixation
 +
** CO2 fixation
 +
** reductive carboxylic acid cycle
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
−
* [[RXN-113]]
+
* '''5''' reaction(s) found
−
== Reaction(s) known to produce the compound ==
+
** [[SUCCCOASYN-RXN]]
−
* [[RXN1F-169]]
+
** [[ACONITATEHYDR-RXN]]
−
== Reaction(s) of unknown directionality ==
+
** [[MALATE-DEH-RXN]]
 +
** [[ACONITATEDEHYDR-RXN]]
 +
** [[FUMHYDR-RXN]]
 +
== Reaction(s) not found ==
 +
* '''7''' reaction(s) not found
 +
** [http://metacyc.org/META/NEW-IMAGE?object=2-OXOGLUTARATE-SYNTHASE-RXN 2-OXOGLUTARATE-SYNTHASE-RXN]
 +
** [http://metacyc.org/META/NEW-IMAGE?object=RXN-7929 RXN-7929]
 +
** [http://metacyc.org/META/NEW-IMAGE?object=CITRATE--COA-LIGASE-RXN CITRATE--COA-LIGASE-RXN]
 +
** [http://metacyc.org/META/NEW-IMAGE?object=RXN-8457 RXN-8457]
 +
** [http://metacyc.org/META/NEW-IMAGE?object=R23-RXN R23-RXN]
 +
** [http://metacyc.org/META/NEW-IMAGE?object=R601-RXN R601-RXN]
 +
** [http://metacyc.org/META/NEW-IMAGE?object=PYRUFLAVREDUCT-RXN PYRUFLAVREDUCT-RXN]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: taxonomic range=TAX-200783}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25201798 25201798]
+
{{#set: common name=reductive TCA cycle II}}
−
* CHEBI:
+
{{#set: common name=reductive tricarboxylic acid cycle|reductive tricarboxylic acid pathway|reductive citric acid cycle|reverse citric acid cycle|carbon fixation|CO2 fixation|reductive carboxylic acid cycle}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=27742 27742]
+
{{#set: reaction found=5}}
−
* LIGAND-CPD:
+
{{#set: reaction not found=7}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C02035 C02035]
+
−
{{#set: smiles=C=C1(C3(O)(CC4(C1)(C([CH]5(C2(C(=O)OC(CCC2)([CH](CC3)4)5)(C)))C([O-])=O)))}}
+
−
{{#set: inchi key=InChIKey=OXFPYCSNYOFUCH-AODVQFRNSA-M}}
+
−
{{#set: common name=gibberellin A20}}
+
−
{{#set: molecular weight=331.388    }}
+
−
{{#set: common name=GA20}}
+
−
{{#set: consumed by=RXN-113}}
+
−
{{#set: produced by=RXN1F-169}}
+

Revision as of 17:00, 10 January 2018

Pathway PWY-5392

  • taxonomic range:
  • common name:
    • reductive TCA cycle II
  • Synonym(s):
    • reductive tricarboxylic acid cycle
    • reductive tricarboxylic acid pathway
    • reductive citric acid cycle
    • reverse citric acid cycle
    • carbon fixation
    • CO2 fixation
    • reductive carboxylic acid cycle

Reaction(s) found

Reaction(s) not found

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=PWY-5951&oldid=11217"