Difference between revisions of "Beta-hydroxydecanoyl-ACPs"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=D-TAGATURONATE D-TAGATURONATE] == * smiles: ** C(O)C(=O)C(O)C(O)C(O)C(=O)[O-] * inchi key: ** I...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GLT-tRNAs GLT-tRNAs] == * common name: ** a tRNAglu * Synonym(s): ** TRNA(GLT) ** tRNAglt == R...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GLT-tRNAs GLT-tRNAs] == |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** a tRNAglu |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** TRNA(GLT) |
| − | ** | + | ** tRNAglt |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[GLURS-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[GLUTRNAREDUCT-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | |||
== External links == | == External links == | ||
| − | + | {{#set: common name=a tRNAglu}} | |
| − | + | {{#set: common name=TRNA(GLT)|tRNAglt}} | |
| − | + | {{#set: consumed by=GLURS-RXN}} | |
| − | + | {{#set: produced by=GLUTRNAREDUCT-RXN}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | + | ||
| − | {{#set: common name= | + | |
| − | {{#set: | + | |
| − | + | ||
| − | {{#set: | + | |
Revision as of 16:00, 10 January 2018
Contents
Metabolite GLT-tRNAs
- common name:
- a tRNAglu
- Synonym(s):
- TRNA(GLT)
- tRNAglt
