Difference between revisions of "PWY-5034"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8984 CPD-8984] == * smiles: ** C3(C=CC(C2(C(C1(C=CC=CC=1))O2))=CC=3) * inchi key: ** InChIK...")
 
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7177 PWY-7177] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] **...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Pathway]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8984 CPD-8984] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7177 PWY-7177] ==
−
* smiles:
+
* taxonomic range:
−
** C3(C=CC(C2(C(C1(C=CC=CC=1))O2))=CC=3)
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
−
* inchi key:
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-2759]
−
** InChIKey=ARCJQKUWGAZPFX-OKILXGFUSA-N
+
 
* common name:
 
* common name:
−
** cis-stilbene oxide
+
** UTP and CTP dephosphorylation II
−
* molecular weight:
+
−
** 196.248   
+
 
* Synonym(s):
 
* Synonym(s):
 +
** pyrimidine nucleotides dephosphorylation
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
−
== Reaction(s) known to produce the compound ==
+
* '''3''' reaction(s) found
−
== Reaction(s) of unknown directionality ==
+
** [[RXN-12199]]
−
* [[3.3.2.9-RXN]]
+
** [[CTPSYN-RXN]]
 +
** [[RXN-12200]]
 +
== Reaction(s) not found ==
 +
* '''0''' reaction(s) not found
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: taxonomic range=TAX-2}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=98511 98511]
+
{{#set: taxonomic range=TAX-2759}}
−
* CHEMSPIDER:
+
{{#set: common name=UTP and CTP dephosphorylation II}}
−
** [http://www.chemspider.com/Chemical-Structure.88966.html 88966]
+
{{#set: common name=pyrimidine nucleotides dephosphorylation}}
−
* CHEBI:
+
{{#set: reaction found=3}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=50004 50004]
+
{{#set: reaction not found=0}}
−
* LIGAND-CPD:
+
−
** [http://www.genome.jp/dbget-bin/www_bget?C16014 C16014]
+
−
* HMDB : HMDB59631
+
−
{{#set: smiles=C3(C=CC(C2(C(C1(C=CC=CC=1))O2))=CC=3)}}
+
−
{{#set: inchi key=InChIKey=ARCJQKUWGAZPFX-OKILXGFUSA-N}}
+
−
{{#set: common name=cis-stilbene oxide}}
+
−
{{#set: molecular weight=196.248    }}
+
−
{{#set: consumed or produced by=3.3.2.9-RXN}}
+

Revision as of 16:01, 10 January 2018

Pathway PWY-7177

  • taxonomic range:
  • common name:
    • UTP and CTP dephosphorylation II
  • Synonym(s):
    • pyrimidine nucleotides dephosphorylation

Reaction(s) found

Reaction(s) not found

  • 0 reaction(s) not found

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=PWY-5034&oldid=11247"