Difference between revisions of "RXN-14074"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GERANYL-PP GERANYL-PP] == * smiles: ** CC(=CCCC(=CCOP([O-])(OP(=O)([O-])[O-])=O)C)C * inchi key...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13935 CPD-13935] == * smiles: ** C2(O)(OC(COC1(OC(CO)C(O)C(O)C(O)1))C(O)C(O)C(O)2) * inchi...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13935 CPD-13935] == |
* smiles: | * smiles: | ||
| − | ** | + | ** C2(O)(OC(COC1(OC(CO)C(O)C(O)C(O)1))C(O)C(O)C(O)2) |
* inchi key: | * inchi key: | ||
| − | ** InChIKey= | + | ** InChIKey=DLRVVLDZNNYCBX-ONPLHCRPSA-N |
* common name: | * common name: | ||
| − | ** | + | ** α1,6-D mannobiose |
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 342.299 |
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** α-D-mannosyl-(1->6)-D-mannose |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[3.2.1.152-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | |||
== External links == | == External links == | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
* LIGAND-CPD: | * LIGAND-CPD: | ||
| − | ** [http://www.genome.jp/dbget-bin/www_bget? | + | ** [http://www.genome.jp/dbget-bin/www_bget?C01728 C01728] |
* CHEMSPIDER: | * CHEMSPIDER: | ||
| − | ** [http://www.chemspider.com/Chemical-Structure. | + | ** [http://www.chemspider.com/Chemical-Structure.388648.html 388648] |
* CHEBI: | * CHEBI: | ||
| − | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=62357 62357] |
| − | * | + | * PUBCHEM: |
| − | {{#set: smiles= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=439557 439557] |
| − | {{#set: inchi key=InChIKey= | + | {{#set: smiles=C2(O)(OC(COC1(OC(CO)C(O)C(O)C(O)1))C(O)C(O)C(O)2)}} |
| − | {{#set: common name= | + | {{#set: inchi key=InChIKey=DLRVVLDZNNYCBX-ONPLHCRPSA-N}} |
| − | {{#set: molecular weight= | + | {{#set: common name=α1,6-D mannobiose}} |
| − | {{#set: common name= | + | {{#set: molecular weight=342.299 }} |
| − | + | {{#set: common name=α-D-mannosyl-(1->6)-D-mannose}} | |
| − | {{#set: produced by= | + | {{#set: produced by=3.2.1.152-RXN}} |
| − | + | ||
Revision as of 16:01, 10 January 2018
Contents
Metabolite CPD-13935
- smiles:
- C2(O)(OC(COC1(OC(CO)C(O)C(O)C(O)1))C(O)C(O)C(O)2)
- inchi key:
- InChIKey=DLRVVLDZNNYCBX-ONPLHCRPSA-N
- common name:
- α1,6-D mannobiose
- molecular weight:
- 342.299
- Synonym(s):
- α-D-mannosyl-(1->6)-D-mannose
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"α-D-mannosyl-(1->6)-D-mannose" cannot be used as a page name in this wiki.
