Difference between revisions of "Tiso gene 1389"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=KDO2-LAUROYL-LIPID-IVA KDO2-LAUROYL-LIPID-IVA] == * smiles: ** CCCCCCCCCCCC(O)CC(=O)NC1(C(OP([O...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15818 CPD-15818] == * smiles: ** [CH](=O)C(O)C(O)C(O)CO * inchi key: ** InChIKey=PYMYPHUHKU...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15818 CPD-15818] == |
* smiles: | * smiles: | ||
− | ** | + | ** [CH](=O)C(O)C(O)C(O)CO |
* inchi key: | * inchi key: | ||
− | ** InChIKey= | + | ** InChIKey=PYMYPHUHKUWMLA-LMVFSUKVSA-N |
* common name: | * common name: | ||
− | ** | + | ** aldehydo-D-ribose |
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 150.131 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
+ | * [[RXN-14883]] | ||
+ | * [[RXN-14882]] | ||
+ | * [[RXN0-5305]] | ||
== External links == | == External links == | ||
* PUBCHEM: | * PUBCHEM: | ||
− | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5311110 5311110] |
* CHEBI: | * CHEBI: | ||
− | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=47014 47014] |
− | * | + | * METABOLIGHTS : MTBLC47014 |
− | + | {{#set: smiles=[CH](=O)C(O)C(O)C(O)CO}} | |
− | + | {{#set: inchi key=InChIKey=PYMYPHUHKUWMLA-LMVFSUKVSA-N}} | |
− | {{#set: smiles= | + | {{#set: common name=aldehydo-D-ribose}} |
− | {{#set: inchi key=InChIKey= | + | {{#set: molecular weight=150.131 }} |
− | {{#set: common name= | + | {{#set: consumed or produced by=RXN-14883|RXN-14882|RXN0-5305}} |
− | {{#set: molecular weight= | + | |
− | {{#set: | + | |
− | + |
Revision as of 16:02, 10 January 2018
Contents
Metabolite CPD-15818
- smiles:
- [CH](=O)C(O)C(O)C(O)CO
- inchi key:
- InChIKey=PYMYPHUHKUWMLA-LMVFSUKVSA-N
- common name:
- aldehydo-D-ribose
- molecular weight:
- 150.131
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CH](=O)C(O)C(O)C(O)CO" cannot be used as a page name in this wiki.