Difference between revisions of "PWY-6963"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_14848 == * left end position: ** 63 * transcription direction: ** POSITIVE * right end position: ** 3801 * centisome position: ** 1.1683977...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ANDROST4ENE ANDROST4ENE] == * smiles: ** CC34(CCC(=O)C=C(CC[CH]1([CH](CCC2(C)(C(CC[CH]12)=O))3)...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ANDROST4ENE ANDROST4ENE] == |
| − | * | + | * smiles: |
| − | ** | + | ** CC34(CCC(=O)C=C(CC[CH]1([CH](CCC2(C)(C(CC[CH]12)=O))3))4) |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=AEMFNILZOJDQLW-QAGGRKNESA-N |
| − | * | + | * common name: |
| − | ** | + | ** androst-4-ene-3,17-dione |
| − | * | + | * molecular weight: |
| − | ** | + | ** 286.413 |
* Synonym(s): | * Synonym(s): | ||
| + | ** 4-androstene-3,17-dione | ||
| + | ** androstenedione | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | == Reaction(s) known to produce the compound == |
| − | + | * [[RXN-12124]] | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | == | + | |
| − | + | ||
== External links == | == External links == | ||
| − | {{#set: | + | * DRUGBANK : DB01536 |
| − | {{#set: | + | * NCI: |
| − | {{#set: | + | ** [http://cactus.nci.nih.gov/ncidb2.2/?nsc=9563 9563] |
| − | {{#set: | + | * CAS : 63-05-8 |
| − | {{#set: | + | * LIPID_MAPS : LMST02020007 |
| − | {{#set: | + | * PUBCHEM: |
| + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=6128 6128] | ||
| + | * HMDB : HMDB00053 | ||
| + | * LIGAND-CPD: | ||
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C00280 C00280] | ||
| + | * CHEBI: | ||
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=16422 16422] | ||
| + | * METABOLIGHTS : MTBLC16422 | ||
| + | {{#set: smiles=CC34(CCC(=O)C=C(CC[CH]1([CH](CCC2(C)(C(CC[CH]12)=O))3))4)}} | ||
| + | {{#set: inchi key=InChIKey=AEMFNILZOJDQLW-QAGGRKNESA-N}} | ||
| + | {{#set: common name=androst-4-ene-3,17-dione}} | ||
| + | {{#set: molecular weight=286.413 }} | ||
| + | {{#set: common name=4-androstene-3,17-dione|androstenedione}} | ||
| + | {{#set: produced by=RXN-12124}} | ||
Revision as of 16:03, 10 January 2018
Contents
Metabolite ANDROST4ENE
- smiles:
- CC34(CCC(=O)C=C(CC[CH]1([CH](CCC2(C)(C(CC[CH]12)=O))3))4)
- inchi key:
- InChIKey=AEMFNILZOJDQLW-QAGGRKNESA-N
- common name:
- androst-4-ene-3,17-dione
- molecular weight:
- 286.413
- Synonym(s):
- 4-androstene-3,17-dione
- androstenedione
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- DRUGBANK : DB01536
- NCI:
- CAS : 63-05-8
- LIPID_MAPS : LMST02020007
- PUBCHEM:
- HMDB : HMDB00053
- LIGAND-CPD:
- CHEBI:
- METABOLIGHTS : MTBLC16422
"CC34(CCC(=O)C=C(CC[CH]1([CH](CCC2(C)(C(CC[CH]12)=O))3))4)" cannot be used as a page name in this wiki.
