Difference between revisions of "URATE"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ARG ARG] == * smiles: ** C(NC(N)=[N+])CCC([N+])C(=O)[O-] * inchi key: ** InChIKey=ODKSFYDXXFIFQ...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15651 CPD-15651] == * smiles: ** CCCCCCC=CCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15651 CPD-15651] == |
* smiles: | * smiles: | ||
− | ** C( | + | ** CCCCCCC=CCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-] |
* inchi key: | * inchi key: | ||
− | ** InChIKey= | + | ** InChIKey=UUIVZEBYPBPKLL-HMXWSVNBSA-J |
* common name: | * common name: | ||
− | ** | + | ** 6-trans-tridecenoyl-CoA |
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 957.819 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** 6E-tridecenoyl-CoA |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[RXN-14785]] |
− | + | ||
− | + | ||
− | + | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | |||
− | |||
== External links == | == External links == | ||
− | |||
− | |||
* PUBCHEM: | * PUBCHEM: | ||
− | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90658572 90658572] |
− | + | {{#set: smiles=CCCCCCC=CCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}} | |
− | + | {{#set: inchi key=InChIKey=UUIVZEBYPBPKLL-HMXWSVNBSA-J}} | |
− | + | {{#set: common name=6-trans-tridecenoyl-CoA}} | |
− | + | {{#set: molecular weight=957.819 }} | |
− | + | {{#set: common name=6E-tridecenoyl-CoA}} | |
− | + | {{#set: consumed by=RXN-14785}} | |
− | + | ||
− | + | ||
− | {{#set: smiles=C( | + | |
− | {{#set: inchi key=InChIKey= | + | |
− | {{#set: common name= | + | |
− | {{#set: molecular weight= | + | |
− | {{#set: common name= | + | |
− | {{#set: consumed by= | + | |
− | + |
Revision as of 16:04, 10 January 2018
Contents
Metabolite CPD-15651
- smiles:
- CCCCCCC=CCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
- inchi key:
- InChIKey=UUIVZEBYPBPKLL-HMXWSVNBSA-J
- common name:
- 6-trans-tridecenoyl-CoA
- molecular weight:
- 957.819
- Synonym(s):
- 6E-tridecenoyl-CoA
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
"CCCCCCC=CCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-" cannot be used as a page name in this wiki.