Difference between revisions of "Tiso gene 4990"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MYRICETIN MYRICETIN] == * smiles: ** C1(C(O)=C(O)C(O)=CC=1C2(OC3(C=C(O)C=C(O)C(C(=O)C([O-])=2)=...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9192 RXN-9192] == * direction: ** LEFT-TO-RIGHT * common name: ** ORF * ec number: ** [http://e...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MYRICETIN MYRICETIN] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9192 RXN-9192] ==
−
* smiles:
+
* direction:
−
** C1(C(O)=C(O)C(O)=CC=1C2(OC3(C=C(O)C=C(O)C(C(=O)C([O-])=2)=3)))
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=IKMDFBPHZNJCSN-UHFFFAOYSA-M
+
 
* common name:
 
* common name:
−
** myricetin
+
** ORF
−
* molecular weight:
+
* ec number:
−
** 317.231   
+
** [http://enzyme.expasy.org/EC/2.3.1.84 EC-2.3.1.84]
 
* Synonym(s):
 
* Synonym(s):
−
** myricitin
 
−
** cannabiscetin
 
−
** myricetol
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
== Reaction(s) known to produce the compound ==
+
* With identifiers:
−
* [[RXN-8450]]
+
** 1 [[GERANIOL]][c] '''+''' 1 [[ACETYL-COA]][c] '''=>''' 1 [[CO-A]][c] '''+''' 1 [[CPD-9758]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 geraniol[c] '''+''' 1 acetyl-CoA[c] '''=>''' 1 coenzyme A[c] '''+''' 1 geranyl acetate[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* [[Tiso_gene_10528]]
 +
** IN-SILICO_ANNOTATION
 +
***EC-NUMBER
 +
== Pathways  ==
 +
* [[PWY-5835]], geranyl acetate biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5835 PWY-5835]
 +
** '''1''' reactions found over '''2''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* [[annotation]]:
 +
** [[pathwaytools]]:
 +
*** [[in-silico_annotation]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25201643 25201643]
+
{{#set: common name=ORF}}
−
* CHEBI:
+
{{#set: ec number=EC-2.3.1.84}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58395 58395]
+
{{#set: gene associated=Tiso_gene_10528}}
−
* LIGAND-CPD:
+
{{#set: in pathway=PWY-5835}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C10107 C10107]
+
{{#set: reconstruction category=annotation}}
−
* HMDB : HMDB02755
+
{{#set: reconstruction tool=pathwaytools}}
−
{{#set: smiles=C1(C(O)=C(O)C(O)=CC=1C2(OC3(C=C(O)C=C(O)C(C(=O)C([O-])=2)=3)))}}
+
{{#set: reconstruction source=in-silico_annotation}}
−
{{#set: inchi key=InChIKey=IKMDFBPHZNJCSN-UHFFFAOYSA-M}}
+
−
{{#set: common name=myricetin}}
+
−
{{#set: molecular weight=317.231    }}
+
−
{{#set: common name=myricitin|cannabiscetin|myricetol}}
+
−
{{#set: produced by=RXN-8450}}
+

Revision as of 17:04, 10 January 2018

Reaction RXN-9192

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • ORF
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 geraniol[c] + 1 acetyl-CoA[c] => 1 coenzyme A[c] + 1 geranyl acetate[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-5835, geranyl acetate biosynthesis: PWY-5835
    • 1 reactions found over 2 reactions in the full pathway

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_4990&oldid=11465"