Difference between revisions of "CYSTINE"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17331 CPD-17331] == * smiles: ** CCC=CCC=CCC=CCC=CCC=CCCCCCCCC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPDQT-28 CPDQT-28] == * smiles: ** CSCCCCCC(=O)C([O-])=O * inchi key: ** InChIKey=TWAIOPPFLZEXC...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPDQT-28 CPDQT-28] == |
* smiles: | * smiles: | ||
− | ** | + | ** CSCCCCCC(=O)C([O-])=O |
* inchi key: | * inchi key: | ||
− | ** InChIKey= | + | ** InChIKey=TWAIOPPFLZEXCO-UHFFFAOYSA-M |
* common name: | * common name: | ||
− | ** ( | + | ** 7-(methylthio)-2-oxoheptanoate |
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 189.249 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** 7-(methylthio)-2-oxoheptanoic acid |
− | + | ||
− | + | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN- | + | * [[RXNQT-4168]] |
+ | * [[RXN-18207]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
* PUBCHEM: | * PUBCHEM: | ||
− | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44237184 44237184] |
− | * | + | * KNAPSACK : C00007645 |
− | + | {{#set: smiles=CSCCCCCC(=O)C([O-])=O}} | |
− | {{#set: smiles= | + | {{#set: inchi key=InChIKey=TWAIOPPFLZEXCO-UHFFFAOYSA-M}} |
− | {{#set: inchi key=InChIKey= | + | {{#set: common name=7-(methylthio)-2-oxoheptanoate}} |
− | {{#set: common name=( | + | {{#set: molecular weight=189.249 }} |
− | {{#set: molecular weight= | + | {{#set: common name=7-(methylthio)-2-oxoheptanoic acid}} |
− | {{#set: common name= | + | {{#set: produced by=RXNQT-4168|RXN-18207}} |
− | {{#set: | + | |
− | + |
Revision as of 16:05, 10 January 2018
Contents
Metabolite CPDQT-28
- smiles:
- CSCCCCCC(=O)C([O-])=O
- inchi key:
- InChIKey=TWAIOPPFLZEXCO-UHFFFAOYSA-M
- common name:
- 7-(methylthio)-2-oxoheptanoate
- molecular weight:
- 189.249
- Synonym(s):
- 7-(methylthio)-2-oxoheptanoic acid
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
- KNAPSACK : C00007645
"CSCCCCCC(=O)C([O-])=O" cannot be used as a page name in this wiki.