Difference between revisions of "CPD-10337"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N-ACETYL-D-MANNOSAMINE-6P N-ACETYL-D-MANNOSAMINE-6P] == * smiles: ** CC(=O)NC1(C(O)OC(COP([O-])...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-HYDROXYPIMELYL-COA 3-HYDROXYPIMELYL-COA] == * smiles: ** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(CC(CCCC...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-HYDROXYPIMELYL-COA 3-HYDROXYPIMELYL-COA] == |
* smiles: | * smiles: | ||
| − | ** CC( | + | ** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(CC(CCCC([O-])=O)O)=O)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-] |
* inchi key: | * inchi key: | ||
| − | ** InChIKey= | + | ** InChIKey=VGEBXBQECGWCRH-JXUSAFQPSA-I |
* common name: | * common name: | ||
| − | ** | + | ** 3-hydroxypimeloyl-CoA |
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 920.648 |
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** 3-hydroxypimelyl-CoA |
| − | ** | + | ** 5-hydroxy-7-oxoheptanoyl-CoA |
| − | + | ** 3-hydroxy-6-carboxyhexanoyl-CoA | |
| − | ** | + | |
| − | + | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| + | * [[RXN-15013]] | ||
== External links == | == External links == | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
* PUBCHEM: | * PUBCHEM: | ||
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45266574 45266574] |
| − | * HMDB : | + | * CHEBI: |
| − | {{#set: smiles=CC( | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57343 57343] |
| − | {{#set: inchi key=InChIKey= | + | * LIGAND-CPD: |
| − | {{#set: common name= | + | ** [http://www.genome.jp/dbget-bin/www_bget?C06714 C06714] |
| − | {{#set: molecular weight= | + | * HMDB : HMDB12155 |
| − | {{#set: common name= | + | {{#set: smiles=CC(C)(C(O)C(=O)NCCC(=O)NCCSC(CC(CCCC([O-])=O)O)=O)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}} |
| − | {{#set: consumed by=RXN- | + | {{#set: inchi key=InChIKey=VGEBXBQECGWCRH-JXUSAFQPSA-I}} |
| + | {{#set: common name=3-hydroxypimeloyl-CoA}} | ||
| + | {{#set: molecular weight=920.648 }} | ||
| + | {{#set: common name=3-hydroxypimelyl-CoA|5-hydroxy-7-oxoheptanoyl-CoA|3-hydroxy-6-carboxyhexanoyl-CoA}} | ||
| + | {{#set: consumed or produced by=RXN-15013}} | ||
Revision as of 16:06, 10 January 2018
Contents
Metabolite 3-HYDROXYPIMELYL-COA
- smiles:
- CC(C)(C(O)C(=O)NCCC(=O)NCCSC(CC(CCCC([O-])=O)O)=O)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
- inchi key:
- InChIKey=VGEBXBQECGWCRH-JXUSAFQPSA-I
- common name:
- 3-hydroxypimeloyl-CoA
- molecular weight:
- 920.648
- Synonym(s):
- 3-hydroxypimelyl-CoA
- 5-hydroxy-7-oxoheptanoyl-CoA
- 3-hydroxy-6-carboxyhexanoyl-CoA
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(C)(C(O)C(=O)NCCC(=O)NCCSC(CC(CCCC([O-])=O)O)=O)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-" cannot be used as a page name in this wiki.
