Difference between revisions of "PWY-7431"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12776 RXN-12776] == * direction: ** LEFT-TO-RIGHT * Synonym(s): == Reaction Formula == * With...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17263 CPD-17263] == * smiles: ** CCC=CCC=CCC=CCC=CCCCCC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17263 CPD-17263] == |
− | * | + | * smiles: |
− | ** | + | ** CCC=CCC=CCC=CCC=CCCCCC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-] |
+ | * inchi key: | ||
+ | ** InChIKey=PCGPHLMAAZKQFQ-FPXDADDUSA-J | ||
+ | * common name: | ||
+ | ** (8Z,11Z,14Z,17Z)-3-hydroxy-icosa-8,11,14,17-tetraenoyl-CoA | ||
+ | * molecular weight: | ||
+ | ** 1065.958 | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** 3-hydroxy-eicosatetraenoyl-CoA | ||
− | == Reaction | + | == Reaction(s) known to consume the compound == |
− | + | == Reaction(s) known to produce the compound == | |
− | + | * [[RXN-16020]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | * [[ | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | {{#set: | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=91819744 91819744] |
− | {{#set: | + | {{#set: smiles=CCC=CCC=CCC=CCC=CCCCCC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}} |
− | {{#set: | + | {{#set: inchi key=InChIKey=PCGPHLMAAZKQFQ-FPXDADDUSA-J}} |
− | {{#set: | + | {{#set: common name=(8Z,11Z,14Z,17Z)-3-hydroxy-icosa-8,11,14,17-tetraenoyl-CoA}} |
− | {{#set: | + | {{#set: molecular weight=1065.958 }} |
+ | {{#set: common name=3-hydroxy-eicosatetraenoyl-CoA}} | ||
+ | {{#set: produced by=RXN-16020}} |
Revision as of 16:06, 10 January 2018
Contents
Metabolite CPD-17263
- smiles:
- CCC=CCC=CCC=CCC=CCCCCC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
- inchi key:
- InChIKey=PCGPHLMAAZKQFQ-FPXDADDUSA-J
- common name:
- (8Z,11Z,14Z,17Z)-3-hydroxy-icosa-8,11,14,17-tetraenoyl-CoA
- molecular weight:
- 1065.958
- Synonym(s):
- 3-hydroxy-eicosatetraenoyl-CoA
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
"CCC=CCC=CCC=CCC=CCCCCC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-" cannot be used as a page name in this wiki.