Difference between revisions of "RXN-11637"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-GLUTAMATE-5-P L-GLUTAMATE-5-P] == * smiles: ** C(CCC(C(=O)[O-])[N+])(OP([O-])(=O)[O-])=O * in...") |
(Created page with "Category:Gene == Gene Tiso_gene_19518 == * left end position: ** 935 * transcription direction: ** POSITIVE * right end position: ** 2250 * centisome position: ** 41.44503...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_19518 == |
− | * | + | * left end position: |
− | ** | + | ** 935 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * right end position: |
− | ** | + | ** 2250 |
− | * | + | * centisome position: |
− | ** | + | ** 41.445034 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | * [[ | + | * [[RXN-5285]] |
− | * | + | ** in-silico_annotation |
− | * [[ | + | ***automated-name-match |
− | == | + | * [[RXN1F-10]] |
− | * [[ | + | ** in-silico_annotation |
− | + | ***automated-name-match | |
+ | == Pathways associated == | ||
+ | * [[CHLOROPHYLL-SYN]] | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=935}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: right end position=2250}} | |
− | + | {{#set: centisome position=41.445034 }} | |
− | + | {{#set: reaction associated=RXN-5285|RXN1F-10}} | |
− | + | {{#set: pathway associated=CHLOROPHYLL-SYN}} | |
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + |
Revision as of 16:06, 10 January 2018
Gene Tiso_gene_19518
- left end position:
- 935
- transcription direction:
- POSITIVE
- right end position:
- 2250
- centisome position:
- 41.445034
- Synonym(s):
Reactions associated
- RXN-5285
- in-silico_annotation
- automated-name-match
- in-silico_annotation
- RXN1F-10
- in-silico_annotation
- automated-name-match
- in-silico_annotation