Difference between revisions of "N-Ac-L-methionyl-L-asparaginyl-Protein"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=R01226 R01226] == * direction: ** LEFT-TO-RIGHT * common name: ** R392 * Synonym(s): == Reaction F...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10139 CPD-10139] == * smiles: ** C=C(C1(CCC2(C(C1)O2)(C)))C * inchi key: ** InChIKey=CCEFMU...")
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=R01226 R01226] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10139 CPD-10139] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** C=C(C1(CCC2(C(C1)O2)(C)))C
 +
* inchi key:
 +
** InChIKey=CCEFMUBVSUDRLG-MGRQHWMJSA-N
 
* common name:
 
* common name:
−
** R392
+
** (+)-(1S,4R)-limonene-1,2- epoxide
 +
* molecular weight:
 +
** 152.236   
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
== Reaction(s) known to produce the compound ==
−
** 1.0 [[METHYLENE-THF]][c] '''+''' 1.0 [[2-KETO-ISOVALERATE]][c] '''+''' 1.0 [[WATER]][c] '''=>''' 1.0 [[THF]][c] '''+''' 1.0 [[2-DEHYDROPANTOATE]][c]
+
== Reaction(s) of unknown directionality ==
−
* With common name(s):
+
* [[RXN-9464]]
−
** 1.0 5,10-methylenetetrahydropteroyl mono-L-glutamate[c] '''+''' 1.0 3-methyl-2-oxobutanoate[c] '''+''' 1.0 H2O[c] '''=>''' 1.0 tetrahydropteroyl mono-L-glutamate[c] '''+''' 1.0 2-dehydropantoate[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Tiso_gene_14465]]
+
−
** [[pantograph]]-[[synechocystis]]
+
−
== Pathways  ==
+
−
== Reconstruction information  ==
+
−
* [[orthology]]:
+
−
** [[pantograph]]:
+
−
*** [[synechocystis]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* PUBCHEM:
−
{{#set: common name=R392}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=12382524 12382524]
−
{{#set: gene associated=Tiso_gene_14465}}
+
* LIGAND-CPD:
−
{{#set: in pathway=}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C07271 C07271]
−
{{#set: reconstruction category=orthology}}
+
* HMDB : HMDB35158
−
{{#set: reconstruction tool=pantograph}}
+
{{#set: smiles=C=C(C1(CCC2(C(C1)O2)(C)))C}}
−
{{#set: reconstruction source=synechocystis}}
+
{{#set: inchi key=InChIKey=CCEFMUBVSUDRLG-MGRQHWMJSA-N}}
 +
{{#set: common name=(+)-(1S,4R)-limonene-1,2- epoxide}}
 +
{{#set: molecular weight=152.236    }}
 +
{{#set: consumed or produced by=RXN-9464}}

Revision as of 17:06, 10 January 2018

Metabolite CPD-10139

  • smiles:
    • C=C(C1(CCC2(C(C1)O2)(C)))C
  • inchi key:
    • InChIKey=CCEFMUBVSUDRLG-MGRQHWMJSA-N
  • common name:
    • (+)-(1S,4R)-limonene-1,2- epoxide
  • molecular weight:
    • 152.236
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=N-Ac-L-methionyl-L-asparaginyl-Protein&oldid=11611"