Difference between revisions of "RXN-14125"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CELLOBIOSE CELLOBIOSE] == * smiles: ** C(C2(C(C(C(C(OC1(C(OC(C(C1O)O)O)CO))O2)O)O)O))O * inchi...") |
(Created page with "Category:Gene == Gene Tiso_gene_13134 == * left end position: ** 268 * transcription direction: ** NEGATIVE * right end position: ** 1714 * centisome position: ** 4.119274...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_13134 == |
− | * | + | * left end position: |
− | ** | + | ** 268 |
− | * | + | * transcription direction: |
− | ** | + | ** NEGATIVE |
− | * | + | * right end position: |
− | ** | + | ** 1714 |
− | * | + | * centisome position: |
− | ** | + | ** 4.1192746 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | * [[ | + | * [[NAD+-ADP-RIBOSYLTRANSFERASE-RXN]] |
− | + | ** in-silico_annotation | |
− | * | + | ***ec-number |
− | * [[ | + | * [[URITRANS-RXN]] |
− | == | + | ** in-silico_annotation |
+ | ***ec-number | ||
+ | == Pathways associated == | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=268}} | |
− | + | {{#set: transcription direction=NEGATIVE}} | |
− | + | {{#set: right end position=1714}} | |
− | + | {{#set: centisome position=4.1192746 }} | |
− | + | {{#set: reaction associated=NAD+-ADP-RIBOSYLTRANSFERASE-RXN|URITRANS-RXN}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + | ||
− | + |
Revision as of 16:08, 10 January 2018
Gene Tiso_gene_13134
- left end position:
- 268
- transcription direction:
- NEGATIVE
- right end position:
- 1714
- centisome position:
- 4.1192746
- Synonym(s):
Reactions associated
- NAD+-ADP-RIBOSYLTRANSFERASE-RXN
- in-silico_annotation
- ec-number
- in-silico_annotation
- URITRANS-RXN
- in-silico_annotation
- ec-number
- in-silico_annotation