Difference between revisions of "Tiso gene 10185"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPDQT-520 CPDQT-520] == * smiles: ** CCCCCCCCC=CCCCCCCCC(=O)OCC(COP(OCC(O)COP([O-])(=O)[O-])([O...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7419 CPD-7419] == * smiles: ** CC(C)=CCCC(C)=CCCC(C)=CC=CC(C)=CC=CC=C(C)C=CC=C(C)C=CC1(=C(C...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7419 CPD-7419] == |
* smiles: | * smiles: | ||
− | ** | + | ** CC(C)=CCCC(C)=CCCC(C)=CC=CC(C)=CC=CC=C(C)C=CC=C(C)C=CC1(=C(C)CCCC(C)(C)1) |
* inchi key: | * inchi key: | ||
− | ** InChIKey= | + | ** InChIKey=MICBIPJWKDDGNL-FILYMEKXSA-N |
* common name: | * common name: | ||
− | ** | + | ** β-zeacarotene |
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 538.898 |
* Synonym(s): | * Synonym(s): | ||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
+ | * [[RXN-8038]] | ||
== External links == | == External links == | ||
+ | * LIPID_MAPS : LMPR01070259 | ||
* PUBCHEM: | * PUBCHEM: | ||
− | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5280790 5280790] |
− | {{#set: smiles= | + | * CHEMSPIDER: |
− | {{#set: inchi key=InChIKey= | + | ** [http://www.chemspider.com/Chemical-Structure.4444348.html 4444348] |
− | {{#set: common name= | + | * CHEBI: |
− | {{#set: molecular weight= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=27533 27533] |
− | + | * LIGAND-CPD: | |
− | {{#set: consumed by=RXN- | + | ** [http://www.genome.jp/dbget-bin/www_bget?C05434 C05434] |
+ | {{#set: smiles=CC(C)=CCCC(C)=CCCC(C)=CC=CC(C)=CC=CC=C(C)C=CC=C(C)C=CC1(=C(C)CCCC(C)(C)1)}} | ||
+ | {{#set: inchi key=InChIKey=MICBIPJWKDDGNL-FILYMEKXSA-N}} | ||
+ | {{#set: common name=β-zeacarotene}} | ||
+ | {{#set: molecular weight=538.898 }} | ||
+ | {{#set: consumed or produced by=RXN-8038}} |
Revision as of 16:08, 10 January 2018
Contents
Metabolite CPD-7419
- smiles:
- CC(C)=CCCC(C)=CCCC(C)=CC=CC(C)=CC=CC=C(C)C=CC=C(C)C=CC1(=C(C)CCCC(C)(C)1)
- inchi key:
- InChIKey=MICBIPJWKDDGNL-FILYMEKXSA-N
- common name:
- β-zeacarotene
- molecular weight:
- 538.898
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links