Difference between revisions of "PWY-7179-1"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1063 CPD-1063] == * smiles: ** CSCC(O)C(O)C(=O)COP([O-])(=O)[O-] * inchi key: ** InChIKey=C...") |
(Created page with "Category:Gene == Gene Tiso_gene_12128 == * left end position: ** 631 * transcription direction: ** NEGATIVE * right end position: ** 6630 * centisome position: ** 5.984446...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_12128 == |
− | * | + | * left end position: |
− | ** | + | ** 631 |
− | * | + | * transcription direction: |
− | ** | + | ** NEGATIVE |
− | * | + | * right end position: |
− | ** | + | ** 6630 |
− | * | + | * centisome position: |
− | ** | + | ** 5.984446 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | + | * [[DNA-DIRECTED-RNA-POLYMERASE-RXN]] | |
− | * [[ | + | ** in-silico_annotation |
− | * [[ | + | ***ec-number |
− | == | + | ** [[pantograph]]-[[esiliculosus]] |
+ | == Pathways associated == | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=631}} | |
− | + | {{#set: transcription direction=NEGATIVE}} | |
− | + | {{#set: right end position=6630}} | |
− | + | {{#set: centisome position=5.984446 }} | |
− | + | {{#set: reaction associated=DNA-DIRECTED-RNA-POLYMERASE-RXN}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + |
Revision as of 16:08, 10 January 2018
Gene Tiso_gene_12128
- left end position:
- 631
- transcription direction:
- NEGATIVE
- right end position:
- 6630
- centisome position:
- 5.984446
- Synonym(s):
Reactions associated
- DNA-DIRECTED-RNA-POLYMERASE-RXN
- in-silico_annotation
- ec-number
- pantograph-esiliculosus
- in-silico_annotation