Difference between revisions of "PWY-7082"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11525 CPD-11525] == * smiles: ** CCC=CCC4(C(=O)CCC(CCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-17851 RXN-17851] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/...")
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11525 CPD-11525] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-17851 RXN-17851] ==
* smiles:
+
* direction:
** CCC=CCC4(C(=O)CCC(CCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])4)
+
** LEFT-TO-RIGHT
* inchi key:
+
* ec number:
** InChIKey=YYUZYSVPFVOYLB-UBQVUSOUSA-J
+
** [http://enzyme.expasy.org/EC/2.3.1.bt EC-2.3.1.bt]
* common name:
+
** OPC4-CoA
+
* molecular weight:
+
** 983.813   
+
 
* Synonym(s):
 
* Synonym(s):
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
* [[RXN-10707]]
+
* With identifiers:
== Reaction(s) known to produce the compound ==
+
** 1 [[L-methionyl-L-glutaminyl-Protein]][c] '''+''' 1 [[ACETYL-COA]][c] '''=>''' 1 [[CO-A]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[N-Ac-L-methionyl-L-glutaminyl-Protein]][c]
* [[RXN-10700]]
+
* With common name(s):
== Reaction(s) of unknown directionality ==
+
** 1 an N-terminal-L-methionyl-L-glutaminyl-[protein][c] '''+''' 1 acetyl-CoA[c] '''=>''' 1 coenzyme A[c] '''+''' 1 H+[c] '''+''' 1 an N-terminal Nα-acetyl-L-methionyl-L-glutaminyl-[protein][c]
 +
 
 +
== Genes associated with this reaction  ==
 +
== Pathways  ==
 +
* [[PWY-7799]], Arg/N-end rule pathway (eukaryotic): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7799 PWY-7799]
 +
** '''8''' reactions found over '''14''' reactions in the full pathway
 +
* [[PWY-7800]], Ac/N-end rule pathway: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7800 PWY-7800]
 +
** '''21''' reactions found over '''21''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* [[annotation]]:
 +
** [[pathwaytools]]:
 +
*** [[experimental_annotation]]
 +
*** [[in-silico_annotation]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44237211 44237211]
+
{{#set: ec number=EC-2.3.1.bt}}
{{#set: smiles=CCC=CCC4(C(=O)CCC(CCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])4)}}
+
{{#set: in pathway=PWY-7799|PWY-7800}}
{{#set: inchi key=InChIKey=YYUZYSVPFVOYLB-UBQVUSOUSA-J}}
+
{{#set: reconstruction category=annotation}}
{{#set: common name=OPC4-CoA}}
+
{{#set: reconstruction tool=pathwaytools}}
{{#set: molecular weight=983.813    }}
+
{{#set: reconstruction source=experimental_annotation|in-silico_annotation}}
{{#set: consumed by=RXN-10707}}
+
{{#set: produced by=RXN-10700}}
+

Revision as of 16:09, 10 January 2018

Reaction RXN-17851

  • direction:
    • LEFT-TO-RIGHT
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Pathways

  • PWY-7799, Arg/N-end rule pathway (eukaryotic): PWY-7799
    • 8 reactions found over 14 reactions in the full pathway
  • PWY-7800, Ac/N-end rule pathway: PWY-7800
    • 21 reactions found over 21 reactions in the full pathway

Reconstruction information

External links