Difference between revisions of "Tiso gene 17028"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_7380 == * left end position: ** 3963 * transcription direction: ** NEGATIVE * right end position: ** 7485 * centisome position: ** 35.24546...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-323 CPD-323] == * smiles: ** CC(C)CCCC(C)[CH]3(CC[CH]4([CH]2(CCC1(=CC(=O)CCC(C)1[CH]2CCC(C)...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-323 CPD-323] == |
− | * | + | * smiles: |
− | ** | + | ** CC(C)CCCC(C)[CH]3(CC[CH]4([CH]2(CCC1(=CC(=O)CCC(C)1[CH]2CCC(C)34)))) |
− | * | + | * inchi key: |
− | ** | + | ** InChIKey=NYOXRYYXRWJDKP-GYKMGIIDSA-N |
− | * | + | * common name: |
− | ** | + | ** cholest-4-en-3-one |
− | * | + | * molecular weight: |
− | ** | + | ** 384.644 |
* Synonym(s): | * Synonym(s): | ||
+ | ** cholestenone | ||
+ | ** 4-cholesten-3-one | ||
+ | ** 4-cholestene-3-one | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | + | == Reaction(s) known to produce the compound == | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | * [[CHOLESTENONE-5-ALPHA-REDUCTASE-RXN]] | |
− | == | + | |
− | * [[ | + | |
− | + | ||
== External links == | == External links == | ||
− | {{#set: | + | * CAS : 601-57-0 |
− | {{#set: | + | * LIPID_MAPS : LMST01010015 |
− | {{#set: | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=91477 91477] |
− | {{#set: | + | * HMDB : HMDB00921 |
− | {{#set: | + | * LIGAND-CPD: |
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C00599 C00599] | ||
+ | * CHEMSPIDER: | ||
+ | ** [http://www.chemspider.com/Chemical-Structure.82602.html 82602] | ||
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=16175 16175] | ||
+ | {{#set: smiles=CC(C)CCCC(C)[CH]3(CC[CH]4([CH]2(CCC1(=CC(=O)CCC(C)1[CH]2CCC(C)34))))}} | ||
+ | {{#set: inchi key=InChIKey=NYOXRYYXRWJDKP-GYKMGIIDSA-N}} | ||
+ | {{#set: common name=cholest-4-en-3-one}} | ||
+ | {{#set: molecular weight=384.644 }} | ||
+ | {{#set: common name=cholestenone|4-cholesten-3-one|4-cholestene-3-one}} | ||
+ | {{#set: consumed or produced by=CHOLESTENONE-5-ALPHA-REDUCTASE-RXN}} |
Revision as of 17:09, 10 January 2018
Contents
Metabolite CPD-323
- smiles:
- CC(C)CCCC(C)[CH]3(CC[CH]4([CH]2(CCC1(=CC(=O)CCC(C)1[CH]2CCC(C)34))))
- inchi key:
- InChIKey=NYOXRYYXRWJDKP-GYKMGIIDSA-N
- common name:
- cholest-4-en-3-one
- molecular weight:
- 384.644
- Synonym(s):
- cholestenone
- 4-cholesten-3-one
- 4-cholestene-3-one
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- CAS : 601-57-0
- LIPID_MAPS : LMST01010015
- PUBCHEM:
- HMDB : HMDB00921
- LIGAND-CPD:
- CHEMSPIDER:
- CHEBI:
"CC(C)CCCC(C)[CH]3(CC[CH]4([CH]2(CCC1(=CC(=O)CCC(C)1[CH]2CCC(C)34))))" cannot be used as a page name in this wiki.