Difference between revisions of "PWY-3162"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=DHAD DHAD] == * direction: ** LEFT-TO-RIGHT * common name: ** dihydroxy-acid dehydratase * Synonym(...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CELLOBIOSE CELLOBIOSE] == * smiles: ** C(C2(C(C(C(C(OC1(C(OC(C(C1O)O)O)CO))O2)O)O)O))O * inchi...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CELLOBIOSE CELLOBIOSE] == |
− | * | + | * smiles: |
− | ** | + | ** C(C2(C(C(C(C(OC1(C(OC(C(C1O)O)O)CO))O2)O)O)O))O |
+ | * inchi key: | ||
+ | ** InChIKey=GUBGYTABKSRVRQ-QRZGKKJRSA-N | ||
* common name: | * common name: | ||
− | ** | + | ** β-D-cellobiose |
+ | * molecular weight: | ||
+ | ** 342.299 | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** 4-O-β-D-glucopyranosyl-β-D-glucopyranose | ||
+ | ** β-D-glucosyl-(1→4)-β-D-glucose | ||
− | == Reaction | + | == Reaction(s) known to consume the compound == |
− | * | + | * [[RXN-10773]] |
− | + | == Reaction(s) known to produce the compound == | |
− | + | * [[RXN-12305]] | |
− | + | * [[3.2.1.91-RXN]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | = | + | |
− | + | ||
− | * [[ | + | |
− | + | ||
− | == | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | {{#set: | + | * CAS : 528-50-7 |
− | {{#set: | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=10712 10712] |
− | {{#set: | + | * HMDB : HMDB00055 |
− | {{#set: | + | * LIGAND-CPD: |
− | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C06422 C06422] |
− | {{#set: | + | * CHEMSPIDER: |
+ | ** [http://www.chemspider.com/Chemical-Structure.10261.html 10261] | ||
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=36217 36217] | ||
+ | {{#set: smiles=C(C2(C(C(C(C(OC1(C(OC(C(C1O)O)O)CO))O2)O)O)O))O}} | ||
+ | {{#set: inchi key=InChIKey=GUBGYTABKSRVRQ-QRZGKKJRSA-N}} | ||
+ | {{#set: common name=β-D-cellobiose}} | ||
+ | {{#set: molecular weight=342.299 }} | ||
+ | {{#set: common name=4-O-β-D-glucopyranosyl-β-D-glucopyranose|β-D-glucosyl-(1→4)-β-D-glucose}} | ||
+ | {{#set: consumed by=RXN-10773}} | ||
+ | {{#set: produced by=RXN-12305|3.2.1.91-RXN}} |
Revision as of 16:09, 10 January 2018
Contents
Metabolite CELLOBIOSE
- smiles:
- C(C2(C(C(C(C(OC1(C(OC(C(C1O)O)O)CO))O2)O)O)O))O
- inchi key:
- InChIKey=GUBGYTABKSRVRQ-QRZGKKJRSA-N
- common name:
- β-D-cellobiose
- molecular weight:
- 342.299
- Synonym(s):
- 4-O-β-D-glucopyranosyl-β-D-glucopyranose
- β-D-glucosyl-(1→4)-β-D-glucose
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links