Difference between revisions of "PROTEIN-ARGININE-DEIMINASE-RXN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17045 CPD-17045] == * smiles: ** C(O)C2(O)(NC(=O)C(O)(CC1(=CC=CC=C1))NC(=O)2) * inchi key:...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6320 PWY-6320] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-3803 TAX-38...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Pathway]] |
− | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6320 PWY-6320] == |
− | * | + | * taxonomic range: |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-3803 TAX-3803] |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** phaselate biosynthesis |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** o-diphenol biosynthesis |
− | + | ||
− | == Reaction(s) | + | == Reaction(s) found == |
− | * [[ | + | * '''1''' reaction(s) found |
− | == Reaction(s) | + | ** [[4-COUMARATE--COA-LIGASE-RXN]] |
− | + | == Reaction(s) not found == | |
+ | * '''4''' reaction(s) not found | ||
+ | ** [http://metacyc.org/META/NEW-IMAGE?object=RXN-10825 RXN-10825] | ||
+ | ** [http://metacyc.org/META/NEW-IMAGE?object=2.3.1.133-RXN 2.3.1.133-RXN] | ||
+ | ** [http://metacyc.org/META/NEW-IMAGE?object=RXN-2621 RXN-2621] | ||
+ | ** [http://metacyc.org/META/NEW-IMAGE?object=RXN-2581 RXN-2581] | ||
== External links == | == External links == | ||
− | + | {{#set: taxonomic range=TAX-3803}} | |
− | + | {{#set: common name=phaselate biosynthesis}} | |
− | {{#set: | + | {{#set: common name=o-diphenol biosynthesis}} |
− | {{#set: | + | {{#set: reaction found=1}} |
− | {{#set: common name= | + | {{#set: reaction not found=4}} |
− | {{#set: | + | |
− | {{#set: | + | |
− | + |
Revision as of 16:10, 10 January 2018
Pathway PWY-6320
- taxonomic range:
- common name:
- phaselate biosynthesis
- Synonym(s):
- o-diphenol biosynthesis
Reaction(s) found
- 1 reaction(s) found
Reaction(s) not found
- 4 reaction(s) not found