Difference between revisions of "Tiso gene 3939"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Tiso_gene_8121 == * left end position: ** 3819 * transcription direction: ** POSITIVE * right end position: ** 6405 * centisome position: ** 36.36450...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17045 CPD-17045] == * smiles: ** C(O)C2(O)(NC(=O)C(O)(CC1(=CC=CC=C1))NC(=O)2) * inchi key:...")
Line 1: Line 1:
−
[[Category:Gene]]
+
[[Category:Metabolite]]
−
== Gene Tiso_gene_8121 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17045 CPD-17045] ==
−
* left end position:
+
* smiles:
−
** 3819
+
** C(O)C2(O)(NC(=O)C(O)(CC1(=CC=CC=C1))NC(=O)2)
−
* transcription direction:
+
* inchi key:
−
** POSITIVE
+
** InChIKey=PXYPZMRMTKVYSM-VXGBXAGGSA-N
−
* right end position:
+
* common name:
−
** 6405
+
** 3-benzyl-3,6-dihydroxy-6-(hydroxymethyl)-diketopiperazine
−
* centisome position:
+
* molecular weight:
−
** 36.364502    
+
** 266.253    
 
* Synonym(s):
 
* Synonym(s):
 +
** 3-benzyl-3,6-dihydroxy-6-(hydroxymethyl)-DKP
 +
** 3-benzyl-3,6-dihydroxy-6-(hydroxymethyl)piperazine-2,5-dione
  
−
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
−
* [[2.7.1.127-RXN]]
+
* [[RXN-15680]]
−
** in-silico_annotation
+
== Reaction(s) known to produce the compound ==
−
***ec-number
+
== Reaction(s) of unknown directionality ==
−
** [[pantograph]]-[[esiliculosus]]
+
−
== Pathways associated ==
+
−
* [[PWY-6364]]
+
−
* [[PWY-6362]]
+
−
* [[PWY-6361]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: left end position=3819}}
+
* PUBCHEM:
−
{{#set: transcription direction=POSITIVE}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90659074 90659074]
−
{{#set: right end position=6405}}
+
{{#set: smiles=C(O)C2(O)(NC(=O)C(O)(CC1(=CC=CC=C1))NC(=O)2)}}
−
{{#set: centisome position=36.364502   }}
+
{{#set: inchi key=InChIKey=PXYPZMRMTKVYSM-VXGBXAGGSA-N}}
−
{{#set: reaction associated=2.7.1.127-RXN}}
+
{{#set: common name=3-benzyl-3,6-dihydroxy-6-(hydroxymethyl)-diketopiperazine}}
−
{{#set: pathway associated=PWY-6364|PWY-6362|PWY-6361}}
+
{{#set: molecular weight=266.253   }}
 +
{{#set: common name=3-benzyl-3,6-dihydroxy-6-(hydroxymethyl)-DKP|3-benzyl-3,6-dihydroxy-6-(hydroxymethyl)piperazine-2,5-dione}}
 +
{{#set: consumed by=RXN-15680}}

Revision as of 16:11, 10 January 2018

Metabolite CPD-17045

  • smiles:
    • C(O)C2(O)(NC(=O)C(O)(CC1(=CC=CC=C1))NC(=O)2)
  • inchi key:
    • InChIKey=PXYPZMRMTKVYSM-VXGBXAGGSA-N
  • common name:
    • 3-benzyl-3,6-dihydroxy-6-(hydroxymethyl)-diketopiperazine
  • molecular weight:
    • 266.253
  • Synonym(s):
    • 3-benzyl-3,6-dihydroxy-6-(hydroxymethyl)-DKP
    • 3-benzyl-3,6-dihydroxy-6-(hydroxymethyl)piperazine-2,5-dione

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links




Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_3939&oldid=11911"