Difference between revisions of "Tiso gene 4620"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_4453 == * left end position: ** 10499 * transcription direction: ** POSITIVE * right end position: ** 11290 * centisome position: ** 70.824...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-3-DIHYDRODIPICOLINATE 2-3-DIHYDRODIPICOLINATE] == * smiles: ** C1(CC(N=C(C=1)C(=O)[O-])C(=O)[...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-3-DIHYDRODIPICOLINATE 2-3-DIHYDRODIPICOLINATE] == |
− | * | + | * smiles: |
− | ** | + | ** C1(CC(N=C(C=1)C(=O)[O-])C(=O)[O-]) |
− | * | + | * inchi key: |
− | ** | + | ** InChIKey=UWOCFOFVIBZJGH-YFKPBYRVSA-L |
− | * | + | * common name: |
− | ** | + | ** (S)-2,3-dihydrodipicolinate |
− | * | + | * molecular weight: |
− | ** | + | ** 167.121 |
* Synonym(s): | * Synonym(s): | ||
+ | ** 2,3-di-H-dipicolinate | ||
+ | ** L-2,3-dihydrodipicolinate | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | == Reaction(s) known to produce the compound == |
− | + | * [[R02292]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | == | + | |
== External links == | == External links == | ||
− | {{#set: | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5460228 5460228] |
− | {{#set: | + | * CHEMSPIDER: |
− | {{#set: | + | ** [http://www.chemspider.com/Chemical-Structure.4573840.html 4573840] |
− | {{#set: | + | * CHEBI: |
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=30620 30620] | ||
+ | * LIGAND-CPD: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C03340 C03340] | ||
+ | * HMDB : HMDB12247 | ||
+ | {{#set: smiles=C1(CC(N=C(C=1)C(=O)[O-])C(=O)[O-])}} | ||
+ | {{#set: inchi key=InChIKey=UWOCFOFVIBZJGH-YFKPBYRVSA-L}} | ||
+ | {{#set: common name=(S)-2,3-dihydrodipicolinate}} | ||
+ | {{#set: molecular weight=167.121 }} | ||
+ | {{#set: common name=2,3-di-H-dipicolinate|L-2,3-dihydrodipicolinate}} | ||
+ | {{#set: produced by=R02292}} |
Revision as of 17:12, 10 January 2018
Contents
Metabolite 2-3-DIHYDRODIPICOLINATE
- smiles:
- C1(CC(N=C(C=1)C(=O)[O-])C(=O)[O-])
- inchi key:
- InChIKey=UWOCFOFVIBZJGH-YFKPBYRVSA-L
- common name:
- (S)-2,3-dihydrodipicolinate
- molecular weight:
- 167.121
- Synonym(s):
- 2,3-di-H-dipicolinate
- L-2,3-dihydrodipicolinate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C1(CC(N=C(C=1)C(=O)[O-])C(=O)[O-])" cannot be used as a page name in this wiki.