Difference between revisions of "PWY-6599"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14873 CPD-14873] == * smiles: ** C(=O)([O-])C1(C=C(N)C(O)=CC=1) * inchi key: ** InChIKey=MR...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=GLYCOLYSIS-E-D GLYCOLYSIS-E-D] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Pathway]] |
− | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=GLYCOLYSIS-E-D GLYCOLYSIS-E-D] == |
− | * | + | * taxonomic range: |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-2759] |
− | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] | |
− | ** | + | |
* common name: | * common name: | ||
− | ** | + | ** superpathway of glycolysis and Entner-Doudoroff |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | == Reaction(s) | + | == Reaction(s) found == |
− | + | * '''4''' reaction(s) found | |
− | == Reaction(s) | + | ** [[GLYCOLYSIS]] |
− | * | + | ** [[ENTNER-DOUDOROFF-PWY]] |
+ | ** [[6PGLUCONOLACT-RXN]] | ||
+ | ** [[GLU6PDEHYDROG-RXN]] | ||
+ | == Reaction(s) not found == | ||
+ | * '''0''' reaction(s) not found | ||
== External links == | == External links == | ||
− | * | + | * ECOCYC: |
− | ** [http:// | + | ** [http://metacyc.org/ECOLI/NEW-IMAGE?object=GLYCOLYSIS-E-D GLYCOLYSIS-E-D] |
− | + | {{#set: taxonomic range=TAX-2759}} | |
− | + | {{#set: taxonomic range=TAX-2}} | |
− | + | {{#set: common name=superpathway of glycolysis and Entner-Doudoroff}} | |
− | + | {{#set: reaction found=4}} | |
− | + | {{#set: reaction not found=0}} | |
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | + | ||
− | {{#set: | + |
Revision as of 16:13, 10 January 2018
Pathway GLYCOLYSIS-E-D
- taxonomic range:
- common name:
- superpathway of glycolysis and Entner-Doudoroff
- Synonym(s):
Reaction(s) found
- 4 reaction(s) found
Reaction(s) not found
- 0 reaction(s) not found
External links
- ECOCYC: