Difference between revisions of "PWY-6339"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_10919 == * left end position: ** 2478 * transcription direction: ** POSITIVE * right end position: ** 7974 * centisome position: ** 30.2305...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=TRP TRP] == * smiles: ** C2(NC1(C=CC=CC=1C(CC([N+])C(=O)[O-])=2)) * inchi key: ** InChIKey=QIVB...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=TRP TRP] == |
| − | * | + | * smiles: |
| − | ** | + | ** C2(NC1(C=CC=CC=1C(CC([N+])C(=O)[O-])=2)) |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=QIVBCDIJIAJPQS-VIFPVBQESA-N |
| − | * | + | * common name: |
| − | ** | + | ** L-tryptophan |
| − | * | + | * molecular weight: |
| − | ** | + | ** 204.228 |
* Synonym(s): | * Synonym(s): | ||
| + | ** trp | ||
| + | ** W | ||
| + | ** tryptacin | ||
| + | ** trofan | ||
| + | ** tryptophan | ||
| + | ** 2-amino-3-indolylpropanic acid | ||
| + | ** L-trp | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | * [[TRYPTOPHAN--TRNA-LIGASE-RXN]] |
| − | + | * [[RME144]] | |
| − | * [[ | + | * [[TRANS-RXN-76]] |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | * [[TRYPSYN-RXN]] | |
| − | + | * [[RXN0-2382]] | |
| − | + | * [[TRANS-RXN-76]] | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | * [[ | + | |
| − | + | ||
| − | == | + | |
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | {{#set: | + | * CAS : 73-22-3 |
| − | {{#set: | + | * METABOLIGHTS : MTBLC57912 |
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=6923516 6923516] |
| − | {{#set: | + | * HMDB : HMDB00929 |
| − | {{#set: | + | * LIGAND-CPD: |
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C00078 C00078] | ||
| + | * CHEBI: | ||
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57912 57912] | ||
| + | * BIGG : trp__L | ||
| + | {{#set: smiles=C2(NC1(C=CC=CC=1C(CC([N+])C(=O)[O-])=2))}} | ||
| + | {{#set: inchi key=InChIKey=QIVBCDIJIAJPQS-VIFPVBQESA-N}} | ||
| + | {{#set: common name=L-tryptophan}} | ||
| + | {{#set: molecular weight=204.228 }} | ||
| + | {{#set: common name=trp|W|tryptacin|trofan|tryptophan|2-amino-3-indolylpropanic acid|L-trp}} | ||
| + | {{#set: consumed by=TRYPTOPHAN--TRNA-LIGASE-RXN|RME144|TRANS-RXN-76}} | ||
| + | {{#set: produced by=TRYPSYN-RXN|RXN0-2382|TRANS-RXN-76}} | ||
Revision as of 16:14, 10 January 2018
Contents
Metabolite TRP
- smiles:
- C2(NC1(C=CC=CC=1C(CC([N+])C(=O)[O-])=2))
- inchi key:
- InChIKey=QIVBCDIJIAJPQS-VIFPVBQESA-N
- common name:
- L-tryptophan
- molecular weight:
- 204.228
- Synonym(s):
- trp
- W
- tryptacin
- trofan
- tryptophan
- 2-amino-3-indolylpropanic acid
- L-trp
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- CAS : 73-22-3
- METABOLIGHTS : MTBLC57912
- PUBCHEM:
- HMDB : HMDB00929
- LIGAND-CPD:
- CHEBI:
- BIGG : trp__L
"C2(NC1(C=CC=CC=1C(CC([N+])C(=O)[O-])=2))" cannot be used as a page name in this wiki.
