Difference between revisions of "ExchangeSeed CPD-3"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7006 CPD-7006] == * smiles: ** C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)OCC=C(C)CCCC(C)CCCC(C)CCC=C(...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-3201 RXN0-3201] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/...")
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7006 CPD-7006] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-3201 RXN0-3201] ==
* smiles:
+
* direction:
** C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)OCC=C(C)CCCC(C)CCCC(C)CCC=C(C)C)C5(=[N+]([Mg--]36([N+]1(=C(C(CC)=C(C)C1=CC=2N34)C=C7(C(C)=C8(C(=O)[C-](C(OC)=O)C5=C(N67)8)))))9))))
+
** LEFT-TO-RIGHT
* inchi key:
+
* ec number:
** InChIKey=NVDIDZKEPDPXJJ-ONWAGYJKSA-M
+
** [http://enzyme.expasy.org/EC/3.4.21 EC-3.4.21]
* common name:
+
** tetrahydrogeranylgeranyl chlorophyll a
+
* molecular weight:
+
** 890.479   
+
 
* Synonym(s):
 
* Synonym(s):
** tetrahydroGG-chlorophyll a
 
** tetrahydroGG-chl a
 
** tetrahydrogeranylgeranyl-chl a
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
* [[RXN-7666]]
+
* With identifiers:
== Reaction(s) known to produce the compound ==
+
** 1 [[cleaved-lipoprotein-signal-peptide]][c] '''+''' 1 [[WATER]][c] '''=>''' n [[Peptides-holder]][c]
* [[RXN-7665]]
+
* With common name(s):
== Reaction(s) of unknown directionality ==
+
** 1 a cleaved lipoprotein signal peptide[c] '''+''' 1 H2O[c] '''=>''' n a peptide[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* [[Tiso_gene_14208]]
 +
** [[pantograph]]-[[esiliculosus]]
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* [[orthology]]:
 +
** [[pantograph]]:
 +
*** [[esiliculosus]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46926313 46926313]
+
{{#set: ec number=EC-3.4.21}}
{{#set: smiles=C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)OCC=C(C)CCCC(C)CCCC(C)CCC=C(C)C)C5(=[N+]([Mg--]36([N+]1(=C(C(CC)=C(C)C1=CC=2N34)C=C7(C(C)=C8(C(=O)[C-](C(OC)=O)C5=C(N67)8)))))9))))}}
+
{{#set: gene associated=Tiso_gene_14208}}
{{#set: inchi key=InChIKey=NVDIDZKEPDPXJJ-ONWAGYJKSA-M}}
+
{{#set: in pathway=}}
{{#set: common name=tetrahydrogeranylgeranyl chlorophyll a}}
+
{{#set: reconstruction category=orthology}}
{{#set: molecular weight=890.479    }}
+
{{#set: reconstruction tool=pantograph}}
{{#set: common name=tetrahydroGG-chlorophyll a|tetrahydroGG-chl a|tetrahydrogeranylgeranyl-chl a}}
+
{{#set: reconstruction source=esiliculosus}}
{{#set: consumed by=RXN-7666}}
+
{{#set: produced by=RXN-7665}}
+

Revision as of 16:15, 10 January 2018

Reaction RXN0-3201

  • direction:
    • LEFT-TO-RIGHT
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links