Difference between revisions of "CPD3DJ-11366"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=tRNA-uridine55 tRNA-uridine55] == * common name: ** a uridine55 in tRNA * Synonym(s): ** a tRNA...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12513 CPD-12513] == * smiles: ** C3(OC(OP(=O)([O-])OP(=O)([O-])OCC1(OC(C(O)C(O)1)N2(C=CC(=O...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12513 CPD-12513] == |
+ | * smiles: | ||
+ | ** C3(OC(OP(=O)([O-])OP(=O)([O-])OCC1(OC(C(O)C(O)1)N2(C=CC(=O)NC(=O)2)))C(O)C(O)C(O)3) | ||
+ | * inchi key: | ||
+ | ** InChIKey=DQQDLYVHOTZLOR-IAZOVDBXSA-L | ||
* common name: | * common name: | ||
− | ** | + | ** UDP-β-L-arabinopyranose |
+ | * molecular weight: | ||
+ | ** 534.263 | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
+ | * [[UDP-ARABINOSE-4-EPIMERASE-RXN]] | ||
== External links == | == External links == | ||
− | {{#set: | + | * PUBCHEM: |
− | {{#set: common name= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25246220 25246220] |
− | {{#set: consumed by= | + | * CHEBI: |
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=61457 61457] | ||
+ | {{#set: smiles=C3(OC(OP(=O)([O-])OP(=O)([O-])OCC1(OC(C(O)C(O)1)N2(C=CC(=O)NC(=O)2)))C(O)C(O)C(O)3)}} | ||
+ | {{#set: inchi key=InChIKey=DQQDLYVHOTZLOR-IAZOVDBXSA-L}} | ||
+ | {{#set: common name=UDP-β-L-arabinopyranose}} | ||
+ | {{#set: molecular weight=534.263 }} | ||
+ | {{#set: consumed or produced by=UDP-ARABINOSE-4-EPIMERASE-RXN}} |
Revision as of 16:16, 10 January 2018
Contents
Metabolite CPD-12513
- smiles:
- C3(OC(OP(=O)([O-])OP(=O)([O-])OCC1(OC(C(O)C(O)1)N2(C=CC(=O)NC(=O)2)))C(O)C(O)C(O)3)
- inchi key:
- InChIKey=DQQDLYVHOTZLOR-IAZOVDBXSA-L
- common name:
- UDP-β-L-arabinopyranose
- molecular weight:
- 534.263
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C3(OC(OP(=O)([O-])OP(=O)([O-])OCC1(OC(C(O)C(O)1)N2(C=CC(=O)NC(=O)2)))C(O)C(O)C(O)3)" cannot be used as a page name in this wiki.