Difference between revisions of "CPD3DJ-11366"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=tRNA-uridine55 tRNA-uridine55] == * common name: ** a uridine55 in tRNA * Synonym(s): ** a tRNA...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12513 CPD-12513] == * smiles: ** C3(OC(OP(=O)([O-])OP(=O)([O-])OCC1(OC(C(O)C(O)1)N2(C=CC(=O...")
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=tRNA-uridine55 tRNA-uridine55] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12513 CPD-12513] ==
 +
* smiles:
 +
** C3(OC(OP(=O)([O-])OP(=O)([O-])OCC1(OC(C(O)C(O)1)N2(C=CC(=O)NC(=O)2)))C(O)C(O)C(O)3)
 +
* inchi key:
 +
** InChIKey=DQQDLYVHOTZLOR-IAZOVDBXSA-L
 
* common name:
 
* common name:
** a uridine55 in tRNA
+
** UDP-β-L-arabinopyranose
 +
* molecular weight:
 +
** 534.263   
 
* Synonym(s):
 
* Synonym(s):
** a tRNA uridine55
 
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-11839]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 +
* [[UDP-ARABINOSE-4-EPIMERASE-RXN]]
 
== External links  ==
 
== External links  ==
{{#set: common name=a uridine55 in tRNA}}
+
* PUBCHEM:
{{#set: common name=a tRNA uridine55}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25246220 25246220]
{{#set: consumed by=RXN-11839}}
+
* CHEBI:
 +
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=61457 61457]
 +
{{#set: smiles=C3(OC(OP(=O)([O-])OP(=O)([O-])OCC1(OC(C(O)C(O)1)N2(C=CC(=O)NC(=O)2)))C(O)C(O)C(O)3)}}
 +
{{#set: inchi key=InChIKey=DQQDLYVHOTZLOR-IAZOVDBXSA-L}}
 +
{{#set: common name=UDP-β-L-arabinopyranose}}
 +
{{#set: molecular weight=534.263    }}
 +
{{#set: consumed or produced by=UDP-ARABINOSE-4-EPIMERASE-RXN}}

Revision as of 17:16, 10 January 2018

Metabolite CPD-12513

  • smiles:
    • C3(OC(OP(=O)([O-])OP(=O)([O-])OCC1(OC(C(O)C(O)1)N2(C=CC(=O)NC(=O)2)))C(O)C(O)C(O)3)
  • inchi key:
    • InChIKey=DQQDLYVHOTZLOR-IAZOVDBXSA-L
  • common name:
    • UDP-β-L-arabinopyranose
  • molecular weight:
    • 534.263
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C3(OC(OP(=O)([O-])OP(=O)([O-])OCC1(OC(C(O)C(O)1)N2(C=CC(=O)NC(=O)2)))C(O)C(O)C(O)3)" cannot be used as a page name in this wiki.