Difference between revisions of "LANOSTEROL"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PORPHOBILINOGEN PORPHOBILINOGEN] == * smiles: ** C(C1(=C(C(=CN1)CCC(=O)[O-])CC(=O)[O-]))[N+] *...") |
(Created page with "Category:Gene == Gene Tiso_gene_18870 == * left end position: ** 10 * transcription direction: ** POSITIVE * right end position: ** 2742 * centisome position: ** 0.3642987...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_18870 == |
− | * | + | * left end position: |
− | ** | + | ** 10 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * right end position: |
− | ** | + | ** 2742 |
− | * | + | * centisome position: |
− | ** | + | ** 0.36429873 |
* Synonym(s): | * Synonym(s): | ||
− | == | + | == Reactions associated == |
− | * [[ | + | * [[3.4.16.4-RXN]] |
− | + | ** in-silico_annotation | |
− | * [[ | + | ***ec-number |
− | == | + | * [[BETA-LACTAMASE-RXN]] |
+ | ** in-silico_annotation | ||
+ | ***automated-name-match | ||
+ | * [[RXN-11065]] | ||
+ | ** in-silico_annotation | ||
+ | ***ec-number | ||
+ | * [[RXN-11302]] | ||
+ | ** in-silico_annotation | ||
+ | ***ec-number | ||
+ | * [[RXN-11351]] | ||
+ | ** in-silico_annotation | ||
+ | ***ec-number | ||
+ | * [[RXN-16649]] | ||
+ | ** in-silico_annotation | ||
+ | ***ec-number | ||
+ | * [[RXN-16659]] | ||
+ | ** in-silico_annotation | ||
+ | ***ec-number | ||
+ | == Pathways associated == | ||
+ | * [[PWY-6471]] | ||
+ | * [[PWY0-1586]] | ||
+ | * [[PWY-5265]] | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=10}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: right end position=2742}} | |
− | + | {{#set: centisome position=0.36429873 }} | |
− | + | {{#set: reaction associated=3.4.16.4-RXN|BETA-LACTAMASE-RXN|RXN-11065|RXN-11302|RXN-11351|RXN-16649|RXN-16659}} | |
− | + | {{#set: pathway associated=PWY-6471|PWY0-1586|PWY-5265}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 16:16, 10 January 2018
Gene Tiso_gene_18870
- left end position:
- 10
- transcription direction:
- POSITIVE
- right end position:
- 2742
- centisome position:
- 0.36429873
- Synonym(s):
Reactions associated
- 3.4.16.4-RXN
- in-silico_annotation
- ec-number
- in-silico_annotation
- BETA-LACTAMASE-RXN
- in-silico_annotation
- automated-name-match
- in-silico_annotation
- RXN-11065
- in-silico_annotation
- ec-number
- in-silico_annotation
- RXN-11302
- in-silico_annotation
- ec-number
- in-silico_annotation
- RXN-11351
- in-silico_annotation
- ec-number
- in-silico_annotation
- RXN-16649
- in-silico_annotation
- ec-number
- in-silico_annotation
- RXN-16659
- in-silico_annotation
- ec-number
- in-silico_annotation