Difference between revisions of "RXN-16132"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=FERULIC-ACID FERULIC-ACID] == * smiles: ** COC1(=CC(C=CC([O-])=O)=CC=C(O)1) * inchi key: ** InC...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=GTUP GTUP] == * direction: ** LEFT-TO-RIGHT * common name: ** GTP:uridine 5'-phosphotransferase * S...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Reaction]] |
| − | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=GTUP GTUP] == |
| − | * | + | * direction: |
| − | ** | + | ** LEFT-TO-RIGHT |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** GTP:uridine 5'-phosphotransferase |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | == Reaction | + | == Reaction Formula == |
| − | * [[ | + | * With identifiers: |
| − | * [[ | + | ** 1.0 [[GTP]][c] '''+''' 1.0 [[URIDINE]][c] '''=>''' 1.0 [[GDP]][c] '''+''' 1.0 [[PROTON]][c] '''+''' 1.0 [[UMP]][c] |
| − | == | + | * With common name(s): |
| − | * [[ | + | ** 1.0 GTP[c] '''+''' 1.0 uridine[c] '''=>''' 1.0 GDP[c] '''+''' 1.0 H+[c] '''+''' 1.0 UMP[c] |
| − | == | + | |
| + | == Genes associated with this reaction == | ||
| + | Genes have been associated with this reaction based on different elements listed below. | ||
| + | * [[Tiso_gene_20134]] | ||
| + | ** [[pantograph]]-[[creinhardtii]] | ||
| + | * [[Tiso_gene_14474]] | ||
| + | ** [[pantograph]]-[[creinhardtii]] | ||
| + | == Pathways == | ||
| + | == Reconstruction information == | ||
| + | * [[orthology]]: | ||
| + | ** [[pantograph]]: | ||
| + | *** [[creinhardtii]] | ||
== External links == | == External links == | ||
| − | + | {{#set: direction=LEFT-TO-RIGHT}} | |
| − | + | {{#set: common name=GTP:uridine 5'-phosphotransferase}} | |
| − | + | {{#set: gene associated=Tiso_gene_20134|Tiso_gene_14474}} | |
| − | + | {{#set: in pathway=}} | |
| − | + | {{#set: reconstruction category=orthology}} | |
| − | + | {{#set: reconstruction tool=pantograph}} | |
| − | + | {{#set: reconstruction source=creinhardtii}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
Revision as of 16:16, 10 January 2018
Contents
Reaction GTUP
- direction:
- LEFT-TO-RIGHT
- common name:
- GTP:uridine 5'-phosphotransferase
- Synonym(s):
Reaction Formula
- With identifiers:
- With common name(s):
- 1.0 GTP[c] + 1.0 uridine[c] => 1.0 GDP[c] + 1.0 H+[c] + 1.0 UMP[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
