Difference between revisions of "RXN-779"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-ORNITHINE L-ORNITHINE] == * smiles: ** C(C[N+])CC([N+])C([O-])=O * inchi key: ** InChIKey=AHL...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5104 PWY-5104] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] **...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Pathway]] |
− | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5104 PWY-5104] == |
− | * | + | * taxonomic range: |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] |
− | * | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-224756 TAX-224756] |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-183925 TAX-183925] |
* common name: | * common name: | ||
− | ** L- | + | ** L-isoleucine biosynthesis IV |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == Reaction(s) | + | == Reaction(s) found == |
− | * [[ | + | * '''3''' reaction(s) found |
− | * | + | ** [[ACETOOHBUTSYN-RXN]] |
− | * [[ | + | ** [[DIHYDROXYMETVALDEHYDRAT-RXN]] |
− | * [[ | + | ** [[BRANCHED-CHAINAMINOTRANSFERILEU-RXN]] |
− | == Reaction(s) | + | == Reaction(s) not found == |
− | * | + | * '''3''' reaction(s) not found |
− | + | ** [http://metacyc.org/META/NEW-IMAGE?object=RXN-16062 RXN-16062] | |
− | + | ** [http://metacyc.org/META/NEW-IMAGE?object=2-OXOBUTYRATE-SYNTHASE-RXN 2-OXOBUTYRATE-SYNTHASE-RXN] | |
− | * | + | ** [http://metacyc.org/META/NEW-IMAGE?object=PROPIONATE--COA-LIGASE-RXN PROPIONATE--COA-LIGASE-RXN] |
− | * [ | + | |
− | * [ | + | |
− | + | ||
− | + | ||
− | * [ | + | |
− | + | ||
== External links == | == External links == | ||
− | + | {{#set: taxonomic range=TAX-2}} | |
− | + | {{#set: taxonomic range=TAX-224756}} | |
− | + | {{#set: taxonomic range=TAX-183925}} | |
− | + | {{#set: common name=L-isoleucine biosynthesis IV}} | |
− | + | {{#set: reaction found=3}} | |
− | + | {{#set: reaction not found=3}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + | ||
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + |
Revision as of 16:16, 10 January 2018
Pathway PWY-5104
- taxonomic range:
- common name:
- L-isoleucine biosynthesis IV
- Synonym(s):
Reaction(s) found
- 3 reaction(s) found
Reaction(s) not found
- 3 reaction(s) not found