Difference between revisions of "1.10.2.2-RXN"

Revision as of 16:17, 10 January 2018

common name:
- an S-sulfanyl-[cysteine desulfurase]-S-sulfanyl-[disordered-form scaffold protein] complex
Synonym(s):

"an S-sulfanyl-[cysteine desulfurase]-S-sulfanyl-[disordered-form scaffold protein] complex" cannot be used as a page name in this wiki.

@@ Line 1: / Line 1: @@
 [[Category:Metabolite]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19395 CPD-19395] ==
+== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=S-CD-S-SP-Complex S-CD-S-SP-Complex] ==
-* smiles:
-** C(NC(CCC(C(=O)[O-])[N+])=O)C(NCC(=O)[O-])=O
-* inchi key:
-** InChIKey=RWAZIEYJAWTKLB-YFKPBYRVSA-M
 * common name:
-** &gamma;-L-glutamyl-glycylglycine
+** an S-sulfanyl-[cysteine desulfurase]-S-sulfanyl-[disordered-form scaffold protein] complex
-* molecular weight:
-** 260.226
 * Synonym(s):
-** &gamma;-L-Glu-Gly-Gly
 == Reaction(s) known to consume the compound ==
+* [[RXN-14386]]
 == Reaction(s) known to produce the compound ==
-* [[RXN-18092]]
+* [[RXN-14385]]
 == Reaction(s) of unknown directionality ==
 == External links  ==
-{{#set: smiles=C(NC(CCC(C(=O)[O-])[N+])=O)C(NCC(=O)[O-])=O}}
+{{#set: common name=an S-sulfanyl-[cysteine desulfurase]-S-sulfanyl-[disordered-form scaffold protein] complex}}
-{{#set: inchi key=InChIKey=RWAZIEYJAWTKLB-YFKPBYRVSA-M}}
+{{#set: consumed by=RXN-14386}}
-{{#set: common name=&gamma;-L-glutamyl-glycylglycine}}
+{{#set: produced by=RXN-14385}}
-{{#set: molecular weight=260.226    }}
-{{#set: common name=&gamma;-L-Glu-Gly-Gly}}
-{{#set: produced by=RXN-18092}}