Difference between revisions of "CPD-17355"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=XYLITOL XYLITOL] == * smiles: ** C(O)C(O)C(O)C(O)CO * inchi key: ** InChIKey=HEBKCHPVOIAQTA-SCD...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7414 CPD-7414] == * smiles: ** CC(=CC=CC=C(C)C=CC=C(C)C=CC1(C(C)(C)CCC=C(C)1))C=CC=C(C)C=CC...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7414 CPD-7414] == |
* smiles: | * smiles: | ||
| − | ** C( | + | ** CC(=CC=CC=C(C)C=CC=C(C)C=CC1(C(C)(C)CCC=C(C)1))C=CC=C(C)C=CC2(C(C)=CCCC(C)(C)2) |
* inchi key: | * inchi key: | ||
| − | ** InChIKey= | + | ** InChIKey=QABFXOMOOYWZLZ-GDBZIMIPSA-N |
* common name: | * common name: | ||
| − | ** | + | ** ε-carotene |
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 536.882 |
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** ε,ε-carotene |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN-8028]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | |||
== External links == | == External links == | ||
| − | |||
| − | |||
| − | |||
* PUBCHEM: | * PUBCHEM: | ||
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=12358808 12358808] |
| − | + | ||
* LIGAND-CPD: | * LIGAND-CPD: | ||
| − | ** [http://www.genome.jp/dbget-bin/www_bget? | + | ** [http://www.genome.jp/dbget-bin/www_bget?C16276 C16276] |
| − | + | {{#set: smiles=CC(=CC=CC=C(C)C=CC=C(C)C=CC1(C(C)(C)CCC=C(C)1))C=CC=C(C)C=CC2(C(C)=CCCC(C)(C)2)}} | |
| − | + | {{#set: inchi key=InChIKey=QABFXOMOOYWZLZ-GDBZIMIPSA-N}} | |
| − | + | {{#set: common name=ε-carotene}} | |
| − | + | {{#set: molecular weight=536.882 }} | |
| − | + | {{#set: common name=ε,ε-carotene}} | |
| − | {{#set: smiles=C( | + | {{#set: produced by=RXN-8028}} |
| − | {{#set: inchi key=InChIKey= | + | |
| − | {{#set: common name= | + | |
| − | {{#set: molecular weight= | + | |
| − | {{#set: common name= | + | |
| − | + | ||
| − | {{#set: | + | |
Revision as of 16:18, 10 January 2018
Contents
Metabolite CPD-7414
- smiles:
- CC(=CC=CC=C(C)C=CC=C(C)C=CC1(C(C)(C)CCC=C(C)1))C=CC=C(C)C=CC2(C(C)=CCCC(C)(C)2)
- inchi key:
- InChIKey=QABFXOMOOYWZLZ-GDBZIMIPSA-N
- common name:
- ε-carotene
- molecular weight:
- 536.882
- Synonym(s):
- ε,ε-carotene
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
