Difference between revisions of "N-terminal-Amino-Acids"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11407 CPD-11407] == * smiles: ** C2(C(I)=C(OC1(C=C(C(OS(=O)(=O)[O-])=C(C=1)I)I))C(=CC=2CC(C...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN6666-4 RXN6666-4] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11407 CPD-11407] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN6666-4 RXN6666-4] ==
−
* smiles:
+
* direction:
−
** C2(C(I)=C(OC1(C=C(C(OS(=O)(=O)[O-])=C(C=1)I)I))C(=CC=2CC(C(=O)[O-])[N+])I)
+
** LEFT-TO-RIGHT
−
* inchi key:
+
* ec number:
−
** InChIKey=QYXIJUZWSSQICT-LBPRGKRZSA-M
+
** [http://enzyme.expasy.org/EC/1.4.3.4 EC-1.4.3.4]
−
* common name:
+
−
** thyroxine sulfate
+
−
* molecular weight:
+
−
** 855.924   
+
 
* Synonym(s):
 
* Synonym(s):
−
** T4 sulfate
 
−
** thyroxine-4-sulfate
 
−
** L-tyrosine, O-(3,5-diiodo-4-(sulfooxy)phenyl)-3,5-diiodo-
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
== Reaction(s) known to produce the compound ==
+
* With identifiers:
−
* [[RXN-10614]]
+
** 1 [[DOPAMINE]][c] '''+''' 1 [[WATER]][c] '''+''' 1 [[OXYGEN-MOLECULE]][c] '''=>''' 1 [[AMMONIUM]][c] '''+''' 1 [[HYDROGEN-PEROXIDE]][c] '''+''' 1 [[34-DIHYDROXYPHENYLACETALDEHYDE]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 dopamine[c] '''+''' 1 H2O[c] '''+''' 1 oxygen[c] '''=>''' 1 ammonium[c] '''+''' 1 hydrogen peroxide[c] '''+''' 1 3,4-dihydroxyphenylacetaldehyde[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* [[Tiso_gene_8756]]
 +
** [[pantograph]]-[[athaliana]]
 +
** [[pantograph]]-[[esiliculosus]]
 +
== Pathways  ==
 +
* [[PWY-7431]], aromatic biogenic amine degradation (bacteria): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7431 PWY-7431]
 +
** '''2''' reactions found over '''8''' reactions in the full pathway
 +
* [[PWY6666-2]], dopamine degradation: [http://metacyc.org/META/NEW-IMAGE?object=PWY6666-2 PWY6666-2]
 +
** '''2''' reactions found over '''5''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* [[orthology]]:
 +
** [[pantograph]]:
 +
*** [[athaliana]]
 +
*** [[esiliculosus]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
* RHEA:
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657726 90657726]
+
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=27946 27946]
−
* CHEBI:
+
* LIGAND-RXN:
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58910 58910]
+
** [http://www.genome.jp/dbget-bin/www_bget?R04300 R04300]
−
{{#set: smiles=C2(C(I)=C(OC1(C=C(C(OS(=O)(=O)[O-])=C(C=1)I)I))C(=CC=2CC(C(=O)[O-])[N+])I)}}
+
{{#set: direction=LEFT-TO-RIGHT}}
−
{{#set: inchi key=InChIKey=QYXIJUZWSSQICT-LBPRGKRZSA-M}}
+
{{#set: ec number=EC-1.4.3.4}}
−
{{#set: common name=thyroxine sulfate}}
+
{{#set: gene associated=Tiso_gene_8756}}
−
{{#set: molecular weight=855.924    }}
+
{{#set: in pathway=PWY-7431|PWY6666-2}}
−
{{#set: common name=T4 sulfate|thyroxine-4-sulfate|L-tyrosine, O-(3,5-diiodo-4-(sulfooxy)phenyl)-3,5-diiodo-}}
+
{{#set: reconstruction category=orthology}}
−
{{#set: produced by=RXN-10614}}
+
{{#set: reconstruction tool=pantograph}}
 +
{{#set: reconstruction source=athaliana|esiliculosus}}

Revision as of 16:18, 10 January 2018

Reaction RXN6666-4

  • direction:
    • LEFT-TO-RIGHT
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-7431, aromatic biogenic amine degradation (bacteria): PWY-7431
    • 2 reactions found over 8 reactions in the full pathway
  • PWY6666-2, dopamine degradation: PWY6666-2
    • 2 reactions found over 5 reactions in the full pathway

Reconstruction information

External links




Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=N-terminal-Amino-Acids&oldid=12349"