Difference between revisions of "PWY-6074"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=UMP UMP] == * smiles: ** C(OP(=O)([O-])[O-])C1(OC(C(O)C(O)1)N2(C=CC(=O)NC(=O)2)) * inchi key: *...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6609 PWY-6609] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2157 TAX-21...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Pathway]] |
− | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6609 PWY-6609] == |
− | * | + | * taxonomic range: |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2157 TAX-2157] |
− | * | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-2759] |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] |
* common name: | * common name: | ||
− | ** | + | ** adenine and adenosine salvage III |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** adenosine nucleotides salvage III |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == Reaction(s) | + | == Reaction(s) found == |
− | * | + | * '''3''' reaction(s) found |
− | + | ** [[HYPOXANPRIBOSYLTRAN-RXN]] | |
− | + | ** [[INOPHOSPHOR-RXN]] | |
− | + | ** [[ADENODEAMIN-RXN]] | |
− | + | == Reaction(s) not found == | |
− | * | + | * '''1''' reaction(s) not found |
− | * [[ | + | ** [http://metacyc.org/META/NEW-IMAGE?object=ADENPHOSPHOR-RXN ADENPHOSPHOR-RXN] |
− | + | ||
− | + | ||
− | + | ||
− | * | + | |
− | * [[ | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | * | + | |
− | * [[ | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == Reaction(s) | + | |
− | * | + | |
− | * [ | + | |
== External links == | == External links == | ||
− | * | + | * ECOCYC: |
− | + | ** [http://metacyc.org/ECOLI/NEW-IMAGE?object=PWY-6609 PWY-6609] | |
− | + | {{#set: taxonomic range=TAX-2157}} | |
− | ** [http:// | + | {{#set: taxonomic range=TAX-2759}} |
− | + | {{#set: taxonomic range=TAX-2}} | |
− | + | {{#set: common name=adenine and adenosine salvage III}} | |
− | + | {{#set: common name=adenosine nucleotides salvage III}} | |
− | + | {{#set: reaction found=3}} | |
− | + | {{#set: reaction not found=1}} | |
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + |
Revision as of 16:19, 10 January 2018
Pathway PWY-6609
- taxonomic range:
- common name:
- adenine and adenosine salvage III
- Synonym(s):
- adenosine nucleotides salvage III
Reaction(s) found
- 3 reaction(s) found
Reaction(s) not found
- 1 reaction(s) not found
External links
- ECOCYC: