Difference between revisions of "CHD-RXN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=16S-rRNA-adenine1518-adenine1519 16S-rRNA-adenine1518-adenine1519] == * common name: ** adenine...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-724 CPD-724] == * smiles: ** CC(C)C(C)C(O)C(O)C(C)[CH]3(CC[CH]4([CH]2(CC(O)[CH]1(CC(O)C(O)C...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-724 CPD-724] == |
| + | * smiles: | ||
| + | ** CC(C)C(C)C(O)C(O)C(C)[CH]3(CC[CH]4([CH]2(CC(O)[CH]1(CC(O)C(O)CC(C)1[CH]2CCC(C)34)))) | ||
| + | * inchi key: | ||
| + | ** InChIKey=CVXIEYXJQSRIAC-KLUYZAHOSA-N | ||
* common name: | * common name: | ||
| − | ** | + | ** 6α-hydroxy-castasterone |
| + | * molecular weight: | ||
| + | ** 466.7 | ||
* Synonym(s): | * Synonym(s): | ||
| + | ** hydroxydeoxocastasterone | ||
| + | ** 6α-hydroxy-6-deoxocastasterone | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-779]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN-778]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | {{#set: common name= | + | * PUBCHEM: |
| − | {{#set: consumed by=RXN- | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=15542699 15542699] |
| + | * CHEBI: | ||
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=20760 20760] | ||
| + | * LIGAND-CPD: | ||
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C15803 C15803] | ||
| + | {{#set: smiles=CC(C)C(C)C(O)C(O)C(C)[CH]3(CC[CH]4([CH]2(CC(O)[CH]1(CC(O)C(O)CC(C)1[CH]2CCC(C)34))))}} | ||
| + | {{#set: inchi key=InChIKey=CVXIEYXJQSRIAC-KLUYZAHOSA-N}} | ||
| + | {{#set: common name=6α-hydroxy-castasterone}} | ||
| + | {{#set: molecular weight=466.7 }} | ||
| + | {{#set: common name=hydroxydeoxocastasterone|6α-hydroxy-6-deoxocastasterone}} | ||
| + | {{#set: consumed by=RXN-779}} | ||
| + | {{#set: produced by=RXN-778}} | ||
Revision as of 16:20, 10 January 2018
Contents
Metabolite CPD-724
- smiles:
- CC(C)C(C)C(O)C(O)C(C)[CH]3(CC[CH]4([CH]2(CC(O)[CH]1(CC(O)C(O)CC(C)1[CH]2CCC(C)34))))
- inchi key:
- InChIKey=CVXIEYXJQSRIAC-KLUYZAHOSA-N
- common name:
- 6α-hydroxy-castasterone
- molecular weight:
- 466.7
- Synonym(s):
- hydroxydeoxocastasterone
- 6α-hydroxy-6-deoxocastasterone
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(C)C(C)C(O)C(O)C(C)[CH]3(CC[CH]4([CH]2(CC(O)[CH]1(CC(O)C(O)CC(C)1[CH]2CCC(C)34))))" cannot be used as a page name in this wiki.
