Difference between revisions of "NARINGENIN-3-DIOXYGENASE-RXN"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=4-ALPHA-METHYL-5-ALPHA-CHOLEST-7-EN-3-ON 4-ALPHA-METHYL-5-ALPHA-CHOLEST-7-EN-3-ON] == * smiles:...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-methionyl-L-leucyl-Protein L-methionyl-L-leucyl-Protein] == * common name: ** an N-terminal-L...")
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=4-ALPHA-METHYL-5-ALPHA-CHOLEST-7-EN-3-ON 4-ALPHA-METHYL-5-ALPHA-CHOLEST-7-EN-3-ON] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-methionyl-L-leucyl-Protein L-methionyl-L-leucyl-Protein] ==
* smiles:
+
** CC(C)CCC[CH](C)[CH]3(CC[CH]4(C2(=CC[CH]1(C(C)C(=O)CCC(C)1[CH]2CCC(C)34))))
+
* inchi key:
+
** InChIKey=OWKGVPXWOHLTSL-LIUJFMQASA-N
+
 
* common name:
 
* common name:
** 4α-methyl-5α-cholest-7-en-3-one
+
** an N-terminal-L-methionyl-L-leucyl-[protein]
* molecular weight:
+
** 398.671   
+
 
* Synonym(s):
 
* Synonym(s):
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-17854]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
* [[1.1.1.170-RXN]]
 
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: common name=an N-terminal-L-methionyl-L-leucyl-[protein]}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=440345 440345]
+
{{#set: consumed by=RXN-17854}}
* CHEMSPIDER:
+
** [http://www.chemspider.com/Chemical-Structure.389311.html 389311]
+
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=16495 16495]
+
* LIGAND-CPD:
+
** [http://www.genome.jp/dbget-bin/www_bget?C04453 C04453]
+
* HMDB : HMDB11606
+
{{#set: smiles=CC(C)CCC[CH](C)[CH]3(CC[CH]4(C2(=CC[CH]1(C(C)C(=O)CCC(C)1[CH]2CCC(C)34))))}}
+
{{#set: inchi key=InChIKey=OWKGVPXWOHLTSL-LIUJFMQASA-N}}
+
{{#set: common name=4α-methyl-5α-cholest-7-en-3-one}}
+
{{#set: molecular weight=398.671    }}
+
{{#set: consumed or produced by=1.1.1.170-RXN}}
+

Revision as of 16:21, 10 January 2018

Metabolite L-methionyl-L-leucyl-Protein

  • common name:
    • an N-terminal-L-methionyl-L-leucyl-[protein]
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"an N-terminal-L-methionyl-L-leucyl-[protein" cannot be used as a page name in this wiki.