Difference between revisions of "RXN-11410"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12483 CPD-12483] == * smiles: ** CN1(C(=O)NC2(=C1C(=O)N(C)C(=O)N2)) * inchi key: ** InChIKe...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6936 PWY-6936] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-3...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Pathway]] |
− | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6936 PWY-6936] == |
− | * | + | * taxonomic range: |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-33090] |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** seleno-amino acid biosynthesis |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Se-amino acid biosynthesis |
+ | ** selenocysteine and selenomethionine biosynthesis | ||
− | == Reaction(s) | + | == Reaction(s) found == |
− | + | * '''4''' reaction(s) found | |
− | * [[RXN- | + | ** [[RXN-12728]] |
− | == Reaction(s) | + | ** [[RXN-12729]] |
+ | ** [[RXN-12726]] | ||
+ | ** [[SERINE-O-ACETTRAN-RXN]] | ||
+ | == Reaction(s) not found == | ||
+ | * '''1''' reaction(s) not found | ||
+ | ** [http://metacyc.org/META/NEW-IMAGE?object=RXN-12730 RXN-12730] | ||
== External links == | == External links == | ||
− | * | + | * PLANTCYC : PWY-6936 |
− | * | + | * ARACYC: |
− | + | ** [http://metacyc.org/ARA/NEW-IMAGE?object=PWY-6936 PWY-6936] | |
− | + | {{#set: taxonomic range=TAX-33090}} | |
− | ** [http:// | + | {{#set: common name=seleno-amino acid biosynthesis}} |
− | + | {{#set: common name=Se-amino acid biosynthesis|selenocysteine and selenomethionine biosynthesis}} | |
− | + | {{#set: reaction found=4}} | |
− | + | {{#set: reaction not found=1}} | |
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + |
Revision as of 16:21, 10 January 2018
Pathway PWY-6936
- taxonomic range:
- common name:
- seleno-amino acid biosynthesis
- Synonym(s):
- Se-amino acid biosynthesis
- selenocysteine and selenomethionine biosynthesis
Reaction(s) found
- 4 reaction(s) found
Reaction(s) not found
- 1 reaction(s) not found
External links
- PLANTCYC : PWY-6936
- ARACYC: