Difference between revisions of "Tiso gene 11453"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DGMP DGMP] == * smiles: ** C(OP(=O)([O-])[O-])C1(OC(CC(O)1)N3(C=NC2(C(=O)NC(N)=NC=23))) * inchi...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7163 PWY-7163] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-91827 TAX-9...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Pathway]] |
− | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7163 PWY-7163] == |
− | * | + | * taxonomic range: |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-91827 TAX-91827] |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** polymethylated kaempferol biosynthesis |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == Reaction(s) | + | == Reaction(s) found == |
− | * | + | * '''1''' reaction(s) found |
− | * [[ | + | ** [[RXN-13935]] |
− | == Reaction(s) | + | == Reaction(s) not found == |
− | * | + | * '''3''' reaction(s) not found |
− | * | + | ** [http://metacyc.org/META/NEW-IMAGE?object=RXN-13936 RXN-13936] |
− | * [ | + | ** [http://metacyc.org/META/NEW-IMAGE?object=RXN-13937 RXN-13937] |
− | * [ | + | ** [http://metacyc.org/META/NEW-IMAGE?object=2.1.1.155-RXN 2.1.1.155-RXN] |
− | * [ | + | |
− | = | + | |
− | + | ||
== External links == | == External links == | ||
− | + | {{#set: taxonomic range=TAX-91827}} | |
− | + | {{#set: common name=polymethylated kaempferol biosynthesis}} | |
− | + | {{#set: reaction found=1}} | |
− | + | {{#set: reaction not found=3}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | + | ||
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + |
Revision as of 16:22, 10 January 2018
Pathway PWY-7163
- taxonomic range:
- common name:
- polymethylated kaempferol biosynthesis
- Synonym(s):
Reaction(s) found
- 1 reaction(s) found
Reaction(s) not found
- 3 reaction(s) not found