Difference between revisions of "PWY66-367"
From metabolic_network
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=VALSYN-PWY VALSYN-PWY] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2157 TA...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=TROPINONE TROPINONE] == * smiles: ** C[N+]1(C2(CCC1CC(=O)C2)) * inchi key: ** InChIKey=QQXLDOJG...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=TROPINONE TROPINONE] == |
| − | * | + | * smiles: |
| − | ** [ | + | ** C[N+]1(C2(CCC1CC(=O)C2)) |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=QQXLDOJGLXJCSE-KNVOCYPGSA-O |
* common name: | * common name: | ||
| − | ** | + | ** tropinone |
| + | * molecular weight: | ||
| + | ** 140.205 | ||
* Synonym(s): | * Synonym(s): | ||
| − | == Reaction(s) | + | == Reaction(s) known to consume the compound == |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | * [[TROPINE-DEHYDROGENASE-RXN]] | |
| − | + | ||
| − | + | ||
| − | == Reaction(s) | + | |
| − | * | + | |
== External links == | == External links == | ||
| − | * | + | * NCI: |
| − | ** [http:// | + | ** [http://cactus.nci.nih.gov/ncidb2.2/?nsc=118012 118012] |
| − | + | * CAS : 532-24-1 | |
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=698003 698003] |
| − | {{#set: common name= | + | * LIGAND-CPD: |
| − | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C00783 C00783] |
| − | {{#set: | + | * CHEMSPIDER: |
| + | ** [http://www.chemspider.com/Chemical-Structure.2789160.html 2789160] | ||
| + | * CHEBI: | ||
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57851 57851] | ||
| + | {{#set: smiles=C[N+]1(C2(CCC1CC(=O)C2))}} | ||
| + | {{#set: inchi key=InChIKey=QQXLDOJGLXJCSE-KNVOCYPGSA-O}} | ||
| + | {{#set: common name=tropinone}} | ||
| + | {{#set: molecular weight=140.205 }} | ||
| + | {{#set: consumed or produced by=TROPINE-DEHYDROGENASE-RXN}} | ||
Revision as of 17:22, 10 January 2018
Contents
Metabolite TROPINONE
- smiles:
- C[N+]1(C2(CCC1CC(=O)C2))
- inchi key:
- InChIKey=QQXLDOJGLXJCSE-KNVOCYPGSA-O
- common name:
- tropinone
- molecular weight:
- 140.205
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C[N+]1(C2(CCC1CC(=O)C2))" cannot be used as a page name in this wiki.
